About 7-chloro-2-fluoro-6-(2-methoxyethoxy)cyclohepta-1,3,6-triene-1-carbaldehyde
7-chloro-2-fluoro-6-(2-methoxyethoxy)cyclohepta-1,3,6-triene-1-carbaldehyde (PubChem CID 143712597) has the molecular formula C11H12ClFO3
and a molecular weight of 246.66 g/mol. Its IUPAC name is 7-chloro-2-fluoro-6-(2-methoxyethoxy)cyclohepta-1,3,6-triene-1-carbaldehyde.
Molecular Properties
| Compound Name | 7-chloro-2-fluoro-6-(2-methoxyethoxy)cyclohepta-1,3,6-triene-1-carbaldehyde |
| PubChem CID | 143712597 |
| Molecular Formula | C11H12ClFO3 |
| Molecular Weight | 246.66 g/mol |
| Exact Mass | 246.05 |
| IUPAC Name | 7-chloro-2-fluoro-6-(2-methoxyethoxy)cyclohepta-1,3,6-triene-1-carbaldehyde |
| SMILES | COCCOC1=C(Cl)C(C=O)=C(F)C=CC1 |
| InChI | InChI=1S/C11H12ClFO3/c1-15-5-6-16-10-4-2-3-9(13)8(7-14)11(10)12/h2-3,7H,4-6H2,1H3 |
| InChIKey | RQVVJTFLDRNHOR-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.66 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 7-chloro-2-fluoro-6-(2-methoxyethoxy)cyclohepta-1,3,6-triene-1-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chloro-2-fluoro-6-(2-methoxyethoxy)cyclohepta-1,3,6-triene-1-carbaldehyde?
The IUPAC name of 7-chloro-2-fluoro-6-(2-methoxyethoxy)cyclohepta-1,3,6-triene-1-carbaldehyde (CID 143712597) is 7-chloro-2-fluoro-6-(2-methoxyethoxy)cyclohepta-1,3,6-triene-1-carbaldehyde.
What is the SMILES notation for 7-chloro-2-fluoro-6-(2-methoxyethoxy)cyclohepta-1,3,6-triene-1-carbaldehyde?
The canonical SMILES for 7-chloro-2-fluoro-6-(2-methoxyethoxy)cyclohepta-1,3,6-triene-1-carbaldehyde is COCCOC1=C(Cl)C(C=O)=C(F)C=CC1.
What is the InChIKey of 7-chloro-2-fluoro-6-(2-methoxyethoxy)cyclohepta-1,3,6-triene-1-carbaldehyde?
The InChIKey is RQVVJTFLDRNHOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12ClFO3/c1-15-5-6-16-10-4-2-3-9(13)8(7-14)11(10)12/h2-3,7H,4-6H2,1H3.
What are the key properties of 7-chloro-2-fluoro-6-(2-methoxyethoxy)cyclohepta-1,3,6-triene-1-carbaldehyde?
7-chloro-2-fluoro-6-(2-methoxyethoxy)cyclohepta-1,3,6-triene-1-carbaldehyde has a molecular weight of 246.66 g/mol, XLogP of 2.48, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloro-2-fluoro-6-(2-methoxyethoxy)cyclohepta-1,3,6-triene-1-carbaldehyde is sourced from PubChem (CID 143712597), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).