About (E)-4-(2,3-dihydropyridin-5-yl)-N-ethyl-5-imino-2-propylpent-1-en-1-amine;molecular hydrogen
(E)-4-(2,3-dihydropyridin-5-yl)-N-ethyl-5-imino-2-propylpent-1-en-1-amine;molecular hydrogen (PubChem CID 143713159) has the molecular formula C15H27N3
and a molecular weight of 249.40 g/mol. Its IUPAC name is (E)-4-(2,3-dihydropyridin-5-yl)-N-ethyl-5-imino-2-propylpent-1-en-1-amine;molecular hydrogen.
Molecular Properties
| Compound Name | (E)-4-(2,3-dihydropyridin-5-yl)-N-ethyl-5-imino-2-propylpent-1-en-1-amine;molecular hydrogen |
| PubChem CID | 143713159 |
| Molecular Formula | C15H27N3 |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.22 |
| IUPAC Name | (E)-4-(2,3-dihydropyridin-5-yl)-N-ethyl-5-imino-2-propylpent-1-en-1-amine;molecular hydrogen |
| SMILES | [H]/N=C/C(C/C(=C/NCC)CCC)C1=CCCN=C1.[H][H] |
| InChI | InChI=1S/C15H25N3.H2/c1-3-6-13(11-17-4-2)9-15(10-16)14-7-5-8-18-12-14;/h7,10-12,15-17H,3-6,8-9H2,1-2H3;1H/b13-11+,16-10+; |
| InChIKey | PJRAIFASAYMUNR-HHKFYJNISA-N |
| XLogP | 3.58 |
| TPSA | 48.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-4-(2,3-dihydropyridin-5-yl)-N-ethyl-5-imino-2-propylpent-1-en-1-amine;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-4-(2,3-dihydropyridin-5-yl)-N-ethyl-5-imino-2-propylpent-1-en-1-amine;molecular hydrogen?
The IUPAC name of (E)-4-(2,3-dihydropyridin-5-yl)-N-ethyl-5-imino-2-propylpent-1-en-1-amine;molecular hydrogen (CID 143713159) is (E)-4-(2,3-dihydropyridin-5-yl)-N-ethyl-5-imino-2-propylpent-1-en-1-amine;molecular hydrogen.
What is the SMILES notation for (E)-4-(2,3-dihydropyridin-5-yl)-N-ethyl-5-imino-2-propylpent-1-en-1-amine;molecular hydrogen?
The canonical SMILES for (E)-4-(2,3-dihydropyridin-5-yl)-N-ethyl-5-imino-2-propylpent-1-en-1-amine;molecular hydrogen is [H]/N=C/C(C/C(=C/NCC)CCC)C1=CCCN=C1.[H][H].
What is the InChIKey of (E)-4-(2,3-dihydropyridin-5-yl)-N-ethyl-5-imino-2-propylpent-1-en-1-amine;molecular hydrogen?
The InChIKey is PJRAIFASAYMUNR-HHKFYJNISA-N. The full InChI is InChI=1S/C15H25N3.H2/c1-3-6-13(11-17-4-2)9-15(10-16)14-7-5-8-18-12-14;/h7,10-12,15-17H,3-6,8-9H2,1-2H3;1H/b13-11+,16-10+;.
What are the key properties of (E)-4-(2,3-dihydropyridin-5-yl)-N-ethyl-5-imino-2-propylpent-1-en-1-amine;molecular hydrogen?
(E)-4-(2,3-dihydropyridin-5-yl)-N-ethyl-5-imino-2-propylpent-1-en-1-amine;molecular hydrogen has a molecular weight of 249.40 g/mol, XLogP of 3.58, 8 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-4-(2,3-dihydropyridin-5-yl)-N-ethyl-5-imino-2-propylpent-1-en-1-amine;molecular hydrogen is sourced from PubChem (CID 143713159), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).