About 2,4-dimethyl-1,3-thiazole;propan-1-ol
2,4-dimethyl-1,3-thiazole;propan-1-ol (PubChem CID 143713331) has the molecular formula C8H15NOS
and a molecular weight of 173.28 g/mol. Its IUPAC name is 2,4-dimethyl-1,3-thiazole;propan-1-ol.
Molecular Properties
| Compound Name | 2,4-dimethyl-1,3-thiazole;propan-1-ol |
| PubChem CID | 143713331 |
| Molecular Formula | C8H15NOS |
| Molecular Weight | 173.28 g/mol |
| Exact Mass | 173.09 |
| IUPAC Name | 2,4-dimethyl-1,3-thiazole;propan-1-ol |
| SMILES | CCCO.Cc1csc(C)n1 |
| InChI | InChI=1S/C5H7NS.C3H8O/c1-4-3-7-5(2)6-4;1-2-3-4/h3H,1-2H3;4H,2-3H2,1H3 |
| InChIKey | XXLRHHABEWVMGG-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.28 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,4-dimethyl-1,3-thiazole;propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dimethyl-1,3-thiazole;propan-1-ol?
The IUPAC name of 2,4-dimethyl-1,3-thiazole;propan-1-ol (CID 143713331) is 2,4-dimethyl-1,3-thiazole;propan-1-ol.
What is the SMILES notation for 2,4-dimethyl-1,3-thiazole;propan-1-ol?
The canonical SMILES for 2,4-dimethyl-1,3-thiazole;propan-1-ol is CCCO.Cc1csc(C)n1.
What is the InChIKey of 2,4-dimethyl-1,3-thiazole;propan-1-ol?
The InChIKey is XXLRHHABEWVMGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7NS.C3H8O/c1-4-3-7-5(2)6-4;1-2-3-4/h3H,1-2H3;4H,2-3H2,1H3.
What are the key properties of 2,4-dimethyl-1,3-thiazole;propan-1-ol?
2,4-dimethyl-1,3-thiazole;propan-1-ol has a molecular weight of 173.28 g/mol, XLogP of 2.15, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dimethyl-1,3-thiazole;propan-1-ol is sourced from PubChem (CID 143713331), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).