C25H25FN2O — CID 143713342
N-[3-ethenyl-4-[1-[2-ethoxy-3-[2-(2-fluorophenyl)ethyl]phenyl]ethenyl]-1H-pyrrol-2-yl]methanimine (PubChem CID 143713342) has the molecular formula C25H25FN2O and a molecular weight of 388.49 g/mol. Its IUPAC name is N-[3-ethenyl-4-[1-[2-ethoxy-3-[2-(2-fluorophenyl)ethyl]phenyl]ethenyl]-1H-pyrrol-2-yl]methanimine.
| Compound Name | N-[3-ethenyl-4-[1-[2-ethoxy-3-[2-(2-fluorophenyl)ethyl]phenyl]ethenyl]-1H-pyrrol-2-yl]methanimine |
|---|---|
| PubChem CID | 143713342 |
| Molecular Formula | C25H25FN2O |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | N-[3-ethenyl-4-[1-[2-ethoxy-3-[2-(2-fluorophenyl)ethyl]phenyl]ethenyl]-1H-pyrrol-2-yl]methanimine |
| SMILES | C=Cc1c(C(=C)c2cccc(CCc3ccccc3F)c2OCC)c[nH]c1N=C |
| InChI | InChI=1S/C25H25FN2O/c1-5-20-22(16-28-25(20)27-4)17(3)21-12-9-11-19(24(21)29-6-2)15-14-18-10-7-8-13-23(18)26/h5,7-13,16,28H,1,3-4,6,14-15H2,2H3 |
| InChIKey | WYWNLYBLEWCPIM-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 37.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|