C21H39N — CID 143713435
ethene;prop-1-ene;2,3,4-trimethyl-3-(2-methylpropyl)-5-propyl-2,4-dihydroazepine (PubChem CID 143713435) has the molecular formula C21H39N and a molecular weight of 305.55 g/mol. Its IUPAC name is ethene;prop-1-ene;2,3,4-trimethyl-3-(2-methylpropyl)-5-propyl-2,4-dihydroazepine.
| Compound Name | ethene;prop-1-ene;2,3,4-trimethyl-3-(2-methylpropyl)-5-propyl-2,4-dihydroazepine |
|---|---|
| PubChem CID | 143713435 |
| Molecular Formula | C21H39N |
| Molecular Weight | 305.55 g/mol |
| Exact Mass | 305.31 |
| IUPAC Name | ethene;prop-1-ene;2,3,4-trimethyl-3-(2-methylpropyl)-5-propyl-2,4-dihydroazepine |
| SMILES | C=C.C=CC.CCCC1=CC=NC(C)C(C)(CC(C)C)C1C |
| InChI | InChI=1S/C16H29N.C3H6.C2H4/c1-7-8-15-9-10-17-14(5)16(6,13(15)4)11-12(2)3;1-3-2;1-2/h9-10,12-14H,7-8,11H2,1-6H3;3H,1H2,2H3;1-2H2 |
| InChIKey | SFPZLHHNCMTNOS-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.55 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|