C24H41NO — CID 143713482
N,N-dimethylmethanamine;ethane;(3Z,8E)-4-ethenyl-11-methyl-7-methylidene-8-prop-2-enylidenedodeca-1,3-dien-1-one (PubChem CID 143713482) has the molecular formula C24H41NO and a molecular weight of 359.60 g/mol. Its IUPAC name is N,N-dimethylmethanamine;ethane;(3Z,8E)-4-ethenyl-11-methyl-7-methylidene-8-prop-2-enylidenedodeca-1,3-dien-1-one.
| Compound Name | N,N-dimethylmethanamine;ethane;(3Z,8E)-4-ethenyl-11-methyl-7-methylidene-8-prop-2-enylidenedodeca-1,3-dien-1-one |
|---|---|
| PubChem CID | 143713482 |
| Molecular Formula | C24H41NO |
| Molecular Weight | 359.60 g/mol |
| Exact Mass | 359.32 |
| IUPAC Name | N,N-dimethylmethanamine;ethane;(3Z,8E)-4-ethenyl-11-methyl-7-methylidene-8-prop-2-enylidenedodeca-1,3-dien-1-one |
| SMILES | C=C/C=C(\CCC(C)C)C(=C)CC/C(C=C)=C/C=C=O.CC.CN(C)C |
| InChI | InChI=1S/C19H26O.C3H9N.C2H6/c1-6-9-19(14-11-16(3)4)17(5)12-13-18(7-2)10-8-15-20;1-4(2)3;1-2/h6-10,16H,1-2,5,11-14H2,3-4H3;1-3H3;1-2H3/b18-10+,19-9+;; |
| InChIKey | QFDVPFSFSKBLDZ-RMHJPRMTSA-N |
| XLogP | 6.58 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.60 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|