About ethane;3-methyl-1H-pyrrolo[3,2-c]pyridine
ethane;3-methyl-1H-pyrrolo[3,2-c]pyridine (PubChem CID 143713533) has the molecular formula C12H20N2
and a molecular weight of 192.31 g/mol. Its IUPAC name is ethane;3-methyl-1H-pyrrolo[3,2-c]pyridine.
Molecular Properties
| Compound Name | ethane;3-methyl-1H-pyrrolo[3,2-c]pyridine |
| PubChem CID | 143713533 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | ethane;3-methyl-1H-pyrrolo[3,2-c]pyridine |
| SMILES | CC.CC.Cc1c[nH]c2ccncc12 |
| InChI | InChI=1S/C8H8N2.2C2H6/c1-6-4-10-8-2-3-9-5-7(6)8;2*1-2/h2-5,10H,1H3;2*1-2H3 |
| InChIKey | HETLKLLJHORZID-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;3-methyl-1H-pyrrolo[3,2-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;3-methyl-1H-pyrrolo[3,2-c]pyridine?
The IUPAC name of ethane;3-methyl-1H-pyrrolo[3,2-c]pyridine (CID 143713533) is ethane;3-methyl-1H-pyrrolo[3,2-c]pyridine.
What is the SMILES notation for ethane;3-methyl-1H-pyrrolo[3,2-c]pyridine?
The canonical SMILES for ethane;3-methyl-1H-pyrrolo[3,2-c]pyridine is CC.CC.Cc1c[nH]c2ccncc12.
What is the InChIKey of ethane;3-methyl-1H-pyrrolo[3,2-c]pyridine?
The InChIKey is HETLKLLJHORZID-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2.2C2H6/c1-6-4-10-8-2-3-9-5-7(6)8;2*1-2/h2-5,10H,1H3;2*1-2H3.
What are the key properties of ethane;3-methyl-1H-pyrrolo[3,2-c]pyridine?
ethane;3-methyl-1H-pyrrolo[3,2-c]pyridine has a molecular weight of 192.31 g/mol, XLogP of 3.92, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;3-methyl-1H-pyrrolo[3,2-c]pyridine is sourced from PubChem (CID 143713533), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).