About 1-methyl-2-(1-methyl-2,5-dihydropyrrol-2-yl)piperidine
1-methyl-2-(1-methyl-2,5-dihydropyrrol-2-yl)piperidine (PubChem CID 143713815) has the molecular formula C11H20N2
and a molecular weight of 180.29 g/mol. Its IUPAC name is 1-methyl-2-(1-methyl-2,5-dihydropyrrol-2-yl)piperidine.
Molecular Properties
| Compound Name | 1-methyl-2-(1-methyl-2,5-dihydropyrrol-2-yl)piperidine |
| PubChem CID | 143713815 |
| Molecular Formula | C11H20N2 |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.16 |
| IUPAC Name | 1-methyl-2-(1-methyl-2,5-dihydropyrrol-2-yl)piperidine |
| SMILES | CN1CC=CC1C1CCCCN1C |
| InChI | InChI=1S/C11H20N2/c1-12-8-4-3-6-10(12)11-7-5-9-13(11)2/h5,7,10-11H,3-4,6,8-9H2,1-2H3 |
| InChIKey | JGMLOLWHBMNZSF-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-2-(1-methyl-2,5-dihydropyrrol-2-yl)piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-2-(1-methyl-2,5-dihydropyrrol-2-yl)piperidine?
The IUPAC name of 1-methyl-2-(1-methyl-2,5-dihydropyrrol-2-yl)piperidine (CID 143713815) is 1-methyl-2-(1-methyl-2,5-dihydropyrrol-2-yl)piperidine.
What is the SMILES notation for 1-methyl-2-(1-methyl-2,5-dihydropyrrol-2-yl)piperidine?
The canonical SMILES for 1-methyl-2-(1-methyl-2,5-dihydropyrrol-2-yl)piperidine is CN1CC=CC1C1CCCCN1C.
What is the InChIKey of 1-methyl-2-(1-methyl-2,5-dihydropyrrol-2-yl)piperidine?
The InChIKey is JGMLOLWHBMNZSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N2/c1-12-8-4-3-6-10(12)11-7-5-9-13(11)2/h5,7,10-11H,3-4,6,8-9H2,1-2H3.
What are the key properties of 1-methyl-2-(1-methyl-2,5-dihydropyrrol-2-yl)piperidine?
1-methyl-2-(1-methyl-2,5-dihydropyrrol-2-yl)piperidine has a molecular weight of 180.29 g/mol, XLogP of 1.34, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-2-(1-methyl-2,5-dihydropyrrol-2-yl)piperidine is sourced from PubChem (CID 143713815), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).