About 5-methyl-N-[(3E)-penta-1,3-dien-3-yl]pyrimidin-2-amine
5-methyl-N-[(3E)-penta-1,3-dien-3-yl]pyrimidin-2-amine (PubChem CID 143713847) has the molecular formula C10H13N3
and a molecular weight of 175.23 g/mol. Its IUPAC name is 5-methyl-N-[(3E)-penta-1,3-dien-3-yl]pyrimidin-2-amine.
Molecular Properties
| Compound Name | 5-methyl-N-[(3E)-penta-1,3-dien-3-yl]pyrimidin-2-amine |
| PubChem CID | 143713847 |
| Molecular Formula | C10H13N3 |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.11 |
| IUPAC Name | 5-methyl-N-[(3E)-penta-1,3-dien-3-yl]pyrimidin-2-amine |
| SMILES | C=C/C(=C\C)Nc1ncc(C)cn1 |
| InChI | InChI=1S/C10H13N3/c1-4-9(5-2)13-10-11-6-8(3)7-12-10/h4-7H,1H2,2-3H3,(H,11,12,13)/b9-5+ |
| InChIKey | SVXFYRGIMWFGSQ-WEVVVXLNSA-N |
| XLogP | 2.29 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 5-methyl-N-[(3E)-penta-1,3-dien-3-yl]pyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-N-[(3E)-penta-1,3-dien-3-yl]pyrimidin-2-amine?
The IUPAC name of 5-methyl-N-[(3E)-penta-1,3-dien-3-yl]pyrimidin-2-amine (CID 143713847) is 5-methyl-N-[(3E)-penta-1,3-dien-3-yl]pyrimidin-2-amine.
What is the SMILES notation for 5-methyl-N-[(3E)-penta-1,3-dien-3-yl]pyrimidin-2-amine?
The canonical SMILES for 5-methyl-N-[(3E)-penta-1,3-dien-3-yl]pyrimidin-2-amine is C=C/C(=C\C)Nc1ncc(C)cn1.
What is the InChIKey of 5-methyl-N-[(3E)-penta-1,3-dien-3-yl]pyrimidin-2-amine?
The InChIKey is SVXFYRGIMWFGSQ-WEVVVXLNSA-N. The full InChI is InChI=1S/C10H13N3/c1-4-9(5-2)13-10-11-6-8(3)7-12-10/h4-7H,1H2,2-3H3,(H,11,12,13)/b9-5+.
What are the key properties of 5-methyl-N-[(3E)-penta-1,3-dien-3-yl]pyrimidin-2-amine?
5-methyl-N-[(3E)-penta-1,3-dien-3-yl]pyrimidin-2-amine has a molecular weight of 175.23 g/mol, XLogP of 2.29, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-N-[(3E)-penta-1,3-dien-3-yl]pyrimidin-2-amine is sourced from PubChem (CID 143713847), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).