About 5-benzyl-3,7-dichloropyrrolo[1,2-b]cinnolin-10-one
5-benzyl-3,7-dichloropyrrolo[1,2-b]cinnolin-10-one (PubChem CID 14371424) has the molecular formula C18H12Cl2N2O
and a molecular weight of 343.21 g/mol. Its IUPAC name is 5-benzyl-3,7-dichloropyrrolo[1,2-b]cinnolin-10-one.
Molecular Properties
| Compound Name | 5-benzyl-3,7-dichloropyrrolo[1,2-b]cinnolin-10-one |
| PubChem CID | 14371424 |
| Molecular Formula | C18H12Cl2N2O |
| Molecular Weight | 343.21 g/mol |
| Exact Mass | 342.03 |
| IUPAC Name | 5-benzyl-3,7-dichloropyrrolo[1,2-b]cinnolin-10-one |
| SMILES | O=c1c2ccc(Cl)cc2n(Cc2ccccc2)n2c(Cl)ccc12 |
| InChI | InChI=1S/C18H12Cl2N2O/c19-13-6-7-14-16(10-13)21(11-12-4-2-1-3-5-12)22-15(18(14)23)8-9-17(22)20/h1-10H,11H2 |
| InChIKey | MWBQQAUZJQHXTN-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 26.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.21 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-benzyl-3,7-dichloropyrrolo[1,2-b]cinnolin-10-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-benzyl-3,7-dichloropyrrolo[1,2-b]cinnolin-10-one?
The IUPAC name of 5-benzyl-3,7-dichloropyrrolo[1,2-b]cinnolin-10-one (CID 14371424) is 5-benzyl-3,7-dichloropyrrolo[1,2-b]cinnolin-10-one.
What is the SMILES notation for 5-benzyl-3,7-dichloropyrrolo[1,2-b]cinnolin-10-one?
The canonical SMILES for 5-benzyl-3,7-dichloropyrrolo[1,2-b]cinnolin-10-one is O=c1c2ccc(Cl)cc2n(Cc2ccccc2)n2c(Cl)ccc12.
What is the InChIKey of 5-benzyl-3,7-dichloropyrrolo[1,2-b]cinnolin-10-one?
The InChIKey is MWBQQAUZJQHXTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12Cl2N2O/c19-13-6-7-14-16(10-13)21(11-12-4-2-1-3-5-12)22-15(18(14)23)8-9-17(22)20/h1-10H,11H2.
What are the key properties of 5-benzyl-3,7-dichloropyrrolo[1,2-b]cinnolin-10-one?
5-benzyl-3,7-dichloropyrrolo[1,2-b]cinnolin-10-one has a molecular weight of 343.21 g/mol, XLogP of 4.61, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-benzyl-3,7-dichloropyrrolo[1,2-b]cinnolin-10-one is sourced from PubChem (CID 14371424), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).