About 2-[(12-chlorotetracen-5-yl)methylamino]-2-methylpropane-1,3-diol;methanesulfonic acid
2-[(12-chlorotetracen-5-yl)methylamino]-2-methylpropane-1,3-diol;methanesulfonic acid (PubChem CID 14371431) has the molecular formula C24H26ClNO5S
and a molecular weight of 475.99 g/mol. Its IUPAC name is 2-[(12-chlorotetracen-5-yl)methylamino]-2-methylpropane-1,3-diol;methanesulfonic acid.
Molecular Properties
| Compound Name | 2-[(12-chlorotetracen-5-yl)methylamino]-2-methylpropane-1,3-diol;methanesulfonic acid |
| PubChem CID | 14371431 |
| Molecular Formula | C24H26ClNO5S |
| Molecular Weight | 475.99 g/mol |
| Exact Mass | 475.12 |
| IUPAC Name | 2-[(12-chlorotetracen-5-yl)methylamino]-2-methylpropane-1,3-diol;methanesulfonic acid |
| SMILES | CC(CO)(CO)NCc1c2ccccc2c(Cl)c2cc3ccccc3cc12.CS(=O)(=O)O |
| InChI | InChI=1S/C23H22ClNO2.CH4O3S/c1-23(13-26,14-27)25-12-21-17-8-4-5-9-18(17)22(24)20-11-16-7-3-2-6-15(16)10-19(20)21;1-5(2,3)4/h2-11,25-27H,12-14H2,1H3;1H3,(H,2,3,4) |
| InChIKey | LOTKZSHTOMRBSJ-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 475.99 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[(12-chlorotetracen-5-yl)methylamino]-2-methylpropane-1,3-diol;methanesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(12-chlorotetracen-5-yl)methylamino]-2-methylpropane-1,3-diol;methanesulfonic acid?
The IUPAC name of 2-[(12-chlorotetracen-5-yl)methylamino]-2-methylpropane-1,3-diol;methanesulfonic acid (CID 14371431) is 2-[(12-chlorotetracen-5-yl)methylamino]-2-methylpropane-1,3-diol;methanesulfonic acid.
What is the SMILES notation for 2-[(12-chlorotetracen-5-yl)methylamino]-2-methylpropane-1,3-diol;methanesulfonic acid?
The canonical SMILES for 2-[(12-chlorotetracen-5-yl)methylamino]-2-methylpropane-1,3-diol;methanesulfonic acid is CC(CO)(CO)NCc1c2ccccc2c(Cl)c2cc3ccccc3cc12.CS(=O)(=O)O.
What is the InChIKey of 2-[(12-chlorotetracen-5-yl)methylamino]-2-methylpropane-1,3-diol;methanesulfonic acid?
The InChIKey is LOTKZSHTOMRBSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H22ClNO2.CH4O3S/c1-23(13-26,14-27)25-12-21-17-8-4-5-9-18(17)22(24)20-11-16-7-3-2-6-15(16)10-19(20)21;1-5(2,3)4/h2-11,25-27H,12-14H2,1H3;1H3,(H,2,3,4).
What are the key properties of 2-[(12-chlorotetracen-5-yl)methylamino]-2-methylpropane-1,3-diol;methanesulfonic acid?
2-[(12-chlorotetracen-5-yl)methylamino]-2-methylpropane-1,3-diol;methanesulfonic acid has a molecular weight of 475.99 g/mol, XLogP of 4.14, 5 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(12-chlorotetracen-5-yl)methylamino]-2-methylpropane-1,3-diol;methanesulfonic acid is sourced from PubChem (CID 14371431), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).