C7H13NO — CID 143715126
(7aR)-1,2,3,3a,4,6,7,7a-octahydropyrano[3,4-c]pyrrole (PubChem CID 143715126) has the molecular formula C7H13NO and a molecular weight of 127.19 g/mol. Its IUPAC name is (7aR)-1,2,3,3a,4,6,7,7a-octahydropyrano[3,4-c]pyrrole.
| Compound Name | (7aR)-1,2,3,3a,4,6,7,7a-octahydropyrano[3,4-c]pyrrole |
|---|---|
| PubChem CID | 143715126 |
| Molecular Formula | C7H13NO |
| Molecular Weight | 127.19 g/mol |
| Exact Mass | 127.10 |
| IUPAC Name | (7aR)-1,2,3,3a,4,6,7,7a-octahydropyrano[3,4-c]pyrrole |
| SMILES | C1C[C@H]2CNCC2CO1 |
| InChI | InChI=1S/C7H13NO/c1-2-9-5-7-4-8-3-6(1)7/h6-8H,1-5H2/t6-,7?/m0/s1 |
| InChIKey | DQEFFFJNBUDCCH-PKPIPKONSA-N |
| XLogP | 0.24 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 127.19 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |