About N-(3,4-dihydro-2H-pyran-6-ylmethyl)-N-methylethanamine
N-(3,4-dihydro-2H-pyran-6-ylmethyl)-N-methylethanamine (PubChem CID 143715170) has the molecular formula C9H17NO
and a molecular weight of 155.24 g/mol. Its IUPAC name is N-(3,4-dihydro-2H-pyran-6-ylmethyl)-N-methylethanamine.
Analyze N-(3,4-dihydro-2H-pyran-6-ylmethyl)-N-methylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3,4-dihydro-2H-pyran-6-ylmethyl)-N-methylethanamine?
The IUPAC name of N-(3,4-dihydro-2H-pyran-6-ylmethyl)-N-methylethanamine (CID 143715170) is N-(3,4-dihydro-2H-pyran-6-ylmethyl)-N-methylethanamine.
What is the SMILES notation for N-(3,4-dihydro-2H-pyran-6-ylmethyl)-N-methylethanamine?
The canonical SMILES for N-(3,4-dihydro-2H-pyran-6-ylmethyl)-N-methylethanamine is CCN(C)CC1=CCCCO1.
What is the InChIKey of N-(3,4-dihydro-2H-pyran-6-ylmethyl)-N-methylethanamine?
The InChIKey is CPYPUNUXOWCEHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO/c1-3-10(2)8-9-6-4-5-7-11-9/h6H,3-5,7-8H2,1-2H3.
What are the key properties of N-(3,4-dihydro-2H-pyran-6-ylmethyl)-N-methylethanamine?
N-(3,4-dihydro-2H-pyran-6-ylmethyl)-N-methylethanamine has a molecular weight of 155.24 g/mol, XLogP of 1.63, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3,4-dihydro-2H-pyran-6-ylmethyl)-N-methylethanamine is sourced from PubChem (CID 143715170), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).