C14H18FNO2 — CID 143715273
3-fluoro-4-(2-hydroxyethyl)-1-[(1R)-1-phenylethyl]pyrrolidin-2-one (PubChem CID 143715273) has the molecular formula C14H18FNO2 and a molecular weight of 251.30 g/mol. Its IUPAC name is 3-fluoro-4-(2-hydroxyethyl)-1-[(1R)-1-phenylethyl]pyrrolidin-2-one.
| Compound Name | 3-fluoro-4-(2-hydroxyethyl)-1-[(1R)-1-phenylethyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 143715273 |
| Molecular Formula | C14H18FNO2 |
| Molecular Weight | 251.30 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | 3-fluoro-4-(2-hydroxyethyl)-1-[(1R)-1-phenylethyl]pyrrolidin-2-one |
| SMILES | C[C@H](c1ccccc1)N1CC(CCO)C(F)C1=O |
| InChI | InChI=1S/C14H18FNO2/c1-10(11-5-3-2-4-6-11)16-9-12(7-8-17)13(15)14(16)18/h2-6,10,12-13,17H,7-9H2,1H3/t10-,12?,13?/m1/s1 |
| InChIKey | VKNAKEWPTIMJHN-QFWMXSHPSA-N |
| XLogP | 1.93 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.30 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |