About (7S)-6,7-dimethyl-2-oxabicyclo[3.2.0]hept-1(5)-ene
(7S)-6,7-dimethyl-2-oxabicyclo[3.2.0]hept-1(5)-ene (PubChem CID 143715717) has the molecular formula C8H12O
and a molecular weight of 124.18 g/mol. Its IUPAC name is (7S)-6,7-dimethyl-2-oxabicyclo[3.2.0]hept-1(5)-ene.
Molecular Properties
| Compound Name | (7S)-6,7-dimethyl-2-oxabicyclo[3.2.0]hept-1(5)-ene |
| PubChem CID | 143715717 |
| Molecular Formula | C8H12O |
| Molecular Weight | 124.18 g/mol |
| Exact Mass | 124.09 |
| IUPAC Name | (7S)-6,7-dimethyl-2-oxabicyclo[3.2.0]hept-1(5)-ene |
| SMILES | CC1C2=C(OCC2)[C@H]1C |
| InChI | InChI=1S/C8H12O/c1-5-6(2)8-7(5)3-4-9-8/h5-6H,3-4H2,1-2H3/t5?,6-/m0/s1 |
| InChIKey | AZCPXCYBUYQNLV-GDVGLLTNSA-N |
| XLogP | 1.95 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.18 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (7S)-6,7-dimethyl-2-oxabicyclo[3.2.0]hept-1(5)-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7S)-6,7-dimethyl-2-oxabicyclo[3.2.0]hept-1(5)-ene?
The IUPAC name of (7S)-6,7-dimethyl-2-oxabicyclo[3.2.0]hept-1(5)-ene (CID 143715717) is (7S)-6,7-dimethyl-2-oxabicyclo[3.2.0]hept-1(5)-ene.
What is the SMILES notation for (7S)-6,7-dimethyl-2-oxabicyclo[3.2.0]hept-1(5)-ene?
The canonical SMILES for (7S)-6,7-dimethyl-2-oxabicyclo[3.2.0]hept-1(5)-ene is CC1C2=C(OCC2)[C@H]1C.
What is the InChIKey of (7S)-6,7-dimethyl-2-oxabicyclo[3.2.0]hept-1(5)-ene?
The InChIKey is AZCPXCYBUYQNLV-GDVGLLTNSA-N. The full InChI is InChI=1S/C8H12O/c1-5-6(2)8-7(5)3-4-9-8/h5-6H,3-4H2,1-2H3/t5?,6-/m0/s1.
What are the key properties of (7S)-6,7-dimethyl-2-oxabicyclo[3.2.0]hept-1(5)-ene?
(7S)-6,7-dimethyl-2-oxabicyclo[3.2.0]hept-1(5)-ene has a molecular weight of 124.18 g/mol, XLogP of 1.95, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (7S)-6,7-dimethyl-2-oxabicyclo[3.2.0]hept-1(5)-ene is sourced from PubChem (CID 143715717), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).