About 4-methyl-6,7-dihydropyrimido[4,5-d]pyridazine
4-methyl-6,7-dihydropyrimido[4,5-d]pyridazine (PubChem CID 143715859) has the molecular formula C7H8N4
and a molecular weight of 148.17 g/mol. Its IUPAC name is 4-methyl-6,7-dihydropyrimido[4,5-d]pyridazine.
Molecular Properties
| Compound Name | 4-methyl-6,7-dihydropyrimido[4,5-d]pyridazine |
| PubChem CID | 143715859 |
| Molecular Formula | C7H8N4 |
| Molecular Weight | 148.17 g/mol |
| Exact Mass | 148.07 |
| IUPAC Name | 4-methyl-6,7-dihydropyrimido[4,5-d]pyridazine |
| SMILES | Cc1ncnc2c1=CNNC=2 |
| InChI | InChI=1S/C7H8N4/c1-5-6-2-10-11-3-7(6)9-4-8-5/h2-4,10-11H,1H3 |
| InChIKey | YOXOISYBAFIYBT-UHFFFAOYSA-N |
| XLogP | -1.63 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.17 |
| LogP ≤ 5 | -1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-methyl-6,7-dihydropyrimido[4,5-d]pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-6,7-dihydropyrimido[4,5-d]pyridazine?
The IUPAC name of 4-methyl-6,7-dihydropyrimido[4,5-d]pyridazine (CID 143715859) is 4-methyl-6,7-dihydropyrimido[4,5-d]pyridazine.
What is the SMILES notation for 4-methyl-6,7-dihydropyrimido[4,5-d]pyridazine?
The canonical SMILES for 4-methyl-6,7-dihydropyrimido[4,5-d]pyridazine is Cc1ncnc2c1=CNNC=2.
What is the InChIKey of 4-methyl-6,7-dihydropyrimido[4,5-d]pyridazine?
The InChIKey is YOXOISYBAFIYBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N4/c1-5-6-2-10-11-3-7(6)9-4-8-5/h2-4,10-11H,1H3.
What are the key properties of 4-methyl-6,7-dihydropyrimido[4,5-d]pyridazine?
4-methyl-6,7-dihydropyrimido[4,5-d]pyridazine has a molecular weight of 148.17 g/mol, XLogP of -1.63, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-6,7-dihydropyrimido[4,5-d]pyridazine is sourced from PubChem (CID 143715859), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).