C9H18N4 — CID 143715882
ethane;1-ethyl-4,6-dimethylidene-1,3,5-triazin-2-amine (PubChem CID 143715882) has the molecular formula C9H18N4 and a molecular weight of 182.27 g/mol. Its IUPAC name is ethane;1-ethyl-4,6-dimethylidene-1,3,5-triazin-2-amine.
| Compound Name | ethane;1-ethyl-4,6-dimethylidene-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 143715882 |
| Molecular Formula | C9H18N4 |
| Molecular Weight | 182.27 g/mol |
| Exact Mass | 182.15 |
| IUPAC Name | ethane;1-ethyl-4,6-dimethylidene-1,3,5-triazin-2-amine |
| SMILES | C=C1N=C(N)N(CC)C(=C)N1.CC |
| InChI | InChI=1S/C7H12N4.C2H6/c1-4-11-6(3)9-5(2)10-7(11)8;1-2/h9H,2-4H2,1H3,(H2,8,10);1-2H3 |
| InChIKey | WDJVSFAZXWGCIU-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.27 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |