C21H31FN2 — CID 143715907
(2Z,4E,5Z)-4-ethylidene-6-N-fluoro-1-N,7-dimethyl-5-[(2E,5Z)-3-methyl-4-methylidenehepta-2,5-dien-2-yl]octa-2,5,7-triene-1,6-diamine (PubChem CID 143715907) has the molecular formula C21H31FN2 and a molecular weight of 330.49 g/mol. Its IUPAC name is (2Z,4E,5Z)-4-ethylidene-6-N-fluoro-1-N,7-dimethyl-5-[(2E,5Z)-3-methyl-4-methylidenehepta-2,5-dien-2-yl]octa-2,5,7-triene-1,6-diamine.
| Compound Name | (2Z,4E,5Z)-4-ethylidene-6-N-fluoro-1-N,7-dimethyl-5-[(2E,5Z)-3-methyl-4-methylidenehepta-2,5-dien-2-yl]octa-2,5,7-triene-1,6-diamine |
|---|---|
| PubChem CID | 143715907 |
| Molecular Formula | C21H31FN2 |
| Molecular Weight | 330.49 g/mol |
| Exact Mass | 330.25 |
| IUPAC Name | (2Z,4E,5Z)-4-ethylidene-6-N-fluoro-1-N,7-dimethyl-5-[(2E,5Z)-3-methyl-4-methylidenehepta-2,5-dien-2-yl]octa-2,5,7-triene-1,6-diamine |
| SMILES | C=C(/C=C\C)/C(C)=C(C)\C(=C(/NF)C(=C)C)C(/C=C\CNC)=C\C |
| InChI | InChI=1S/C21H31FN2/c1-9-12-16(5)17(6)18(7)20(21(24-22)15(3)4)19(10-2)13-11-14-23-8/h9-13,23-24H,3,5,14H2,1-2,4,6-8H3/b12-9-,13-11-,18-17+,19-10+,21-20+ |
| InChIKey | DXLAYKDEKZQGON-QHANTHKYSA-N |
| XLogP | 5.48 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.49 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|