About ethane;4-methyl-6,7-dihydroisoquinoline
ethane;4-methyl-6,7-dihydroisoquinoline (PubChem CID 143716079) has the molecular formula C14H23N
and a molecular weight of 205.34 g/mol. Its IUPAC name is ethane;4-methyl-6,7-dihydroisoquinoline.
Molecular Properties
| Compound Name | ethane;4-methyl-6,7-dihydroisoquinoline |
| PubChem CID | 143716079 |
| Molecular Formula | C14H23N |
| Molecular Weight | 205.34 g/mol |
| Exact Mass | 205.18 |
| IUPAC Name | ethane;4-methyl-6,7-dihydroisoquinoline |
| SMILES | CC.CC.Cc1cncc2c1=CCCC=2 |
| InChI | InChI=1S/C10H11N.2C2H6/c1-8-6-11-7-9-4-2-3-5-10(8)9;2*1-2/h4-7H,2-3H2,1H3;2*1-2H3 |
| InChIKey | AGDUQEKENHCCDS-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.34 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;4-methyl-6,7-dihydroisoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;4-methyl-6,7-dihydroisoquinoline?
The IUPAC name of ethane;4-methyl-6,7-dihydroisoquinoline (CID 143716079) is ethane;4-methyl-6,7-dihydroisoquinoline.
What is the SMILES notation for ethane;4-methyl-6,7-dihydroisoquinoline?
The canonical SMILES for ethane;4-methyl-6,7-dihydroisoquinoline is CC.CC.Cc1cncc2c1=CCCC=2.
What is the InChIKey of ethane;4-methyl-6,7-dihydroisoquinoline?
The InChIKey is AGDUQEKENHCCDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N.2C2H6/c1-8-6-11-7-9-4-2-3-5-10(8)9;2*1-2/h4-7H,2-3H2,1H3;2*1-2H3.
What are the key properties of ethane;4-methyl-6,7-dihydroisoquinoline?
ethane;4-methyl-6,7-dihydroisoquinoline has a molecular weight of 205.34 g/mol, XLogP of 2.80, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;4-methyl-6,7-dihydroisoquinoline is sourced from PubChem (CID 143716079), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).