About ethyl formate;6-methylpyridine-2-carboxylic acid
ethyl formate;6-methylpyridine-2-carboxylic acid (PubChem CID 143716127) has the molecular formula C10H13NO4
and a molecular weight of 211.22 g/mol. Its IUPAC name is ethyl formate;6-methylpyridine-2-carboxylic acid.
Molecular Properties
| Compound Name | ethyl formate;6-methylpyridine-2-carboxylic acid |
| PubChem CID | 143716127 |
| Molecular Formula | C10H13NO4 |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | ethyl formate;6-methylpyridine-2-carboxylic acid |
| SMILES | CCOC=O.Cc1cccc(C(=O)O)n1 |
| InChI | InChI=1S/C7H7NO2.C3H6O2/c1-5-3-2-4-6(8-5)7(9)10;1-2-5-3-4/h2-4H,1H3,(H,9,10);3H,2H2,1H3 |
| InChIKey | DXFLTCVBIQBLRE-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 76.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze ethyl formate;6-methylpyridine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl formate;6-methylpyridine-2-carboxylic acid?
The IUPAC name of ethyl formate;6-methylpyridine-2-carboxylic acid (CID 143716127) is ethyl formate;6-methylpyridine-2-carboxylic acid.
What is the SMILES notation for ethyl formate;6-methylpyridine-2-carboxylic acid?
The canonical SMILES for ethyl formate;6-methylpyridine-2-carboxylic acid is CCOC=O.Cc1cccc(C(=O)O)n1.
What is the InChIKey of ethyl formate;6-methylpyridine-2-carboxylic acid?
The InChIKey is DXFLTCVBIQBLRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO2.C3H6O2/c1-5-3-2-4-6(8-5)7(9)10;1-2-5-3-4/h2-4H,1H3,(H,9,10);3H,2H2,1H3.
What are the key properties of ethyl formate;6-methylpyridine-2-carboxylic acid?
ethyl formate;6-methylpyridine-2-carboxylic acid has a molecular weight of 211.22 g/mol, XLogP of 1.27, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl formate;6-methylpyridine-2-carboxylic acid is sourced from PubChem (CID 143716127), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).