ethyl formate;6-methylpyridine-2-carboxylic acid

C10H13NO4 — CID 143716127

IUPACethyl formate;6-methylpyridine-2-carboxylic acid
SMILESCCOC=O.Cc1cccc(C(=O)O)n1
InChIInChI=1S/C7H7NO2.C3H6O2/c1-5-3-2-4-6(8-5)7(9)10;1-2-5-3-4/h2-4H,1H3,(H,9,10);3H,2H2,1H3
InChIKeyDXFLTCVBIQBLRE-UHFFFAOYSA-N
MW211.22 g/mol
LogP1.27
Rot. Bonds3

About ethyl formate;6-methylpyridine-2-carboxylic acid

ethyl formate;6-methylpyridine-2-carboxylic acid (PubChem CID 143716127) has the molecular formula C10H13NO4 and a molecular weight of 211.22 g/mol. Its IUPAC name is ethyl formate;6-methylpyridine-2-carboxylic acid.

Molecular Properties

Compound Nameethyl formate;6-methylpyridine-2-carboxylic acid
PubChem CID143716127
Molecular FormulaC10H13NO4
Molecular Weight211.22 g/mol
Exact Mass211.08
IUPAC Nameethyl formate;6-methylpyridine-2-carboxylic acid
SMILESCCOC=O.Cc1cccc(C(=O)O)n1
InChIInChI=1S/C7H7NO2.C3H6O2/c1-5-3-2-4-6(8-5)7(9)10;1-2-5-3-4/h2-4H,1H3,(H,9,10);3H,2H2,1H3
InChIKeyDXFLTCVBIQBLRE-UHFFFAOYSA-N
XLogP1.27
TPSA76.49 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500211.22
LogP ≤ 51.27
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aldehyde', 'substructure': 'N/A'}

Analyze ethyl formate;6-methylpyridine-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethyl formate;6-methylpyridine-2-carboxylic acid?
The IUPAC name of ethyl formate;6-methylpyridine-2-carboxylic acid (CID 143716127) is ethyl formate;6-methylpyridine-2-carboxylic acid.
What is the SMILES notation for ethyl formate;6-methylpyridine-2-carboxylic acid?
The canonical SMILES for ethyl formate;6-methylpyridine-2-carboxylic acid is CCOC=O.Cc1cccc(C(=O)O)n1.
What is the InChIKey of ethyl formate;6-methylpyridine-2-carboxylic acid?
The InChIKey is DXFLTCVBIQBLRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO2.C3H6O2/c1-5-3-2-4-6(8-5)7(9)10;1-2-5-3-4/h2-4H,1H3,(H,9,10);3H,2H2,1H3.
What are the key properties of ethyl formate;6-methylpyridine-2-carboxylic acid?
ethyl formate;6-methylpyridine-2-carboxylic acid has a molecular weight of 211.22 g/mol, XLogP of 1.27, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl formate;6-methylpyridine-2-carboxylic acid is sourced from PubChem (CID 143716127), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).