About 6-chloro-2-methyl-2,3-dihydropyrano[2,3-b]pyridin-4-one
6-chloro-2-methyl-2,3-dihydropyrano[2,3-b]pyridin-4-one (PubChem CID 14371710) has the molecular formula C9H8ClNO2
and a molecular weight of 197.62 g/mol. Its IUPAC name is 6-chloro-2-methyl-2,3-dihydropyrano[2,3-b]pyridin-4-one.
Molecular Properties
| Compound Name | 6-chloro-2-methyl-2,3-dihydropyrano[2,3-b]pyridin-4-one |
| PubChem CID | 14371710 |
| Molecular Formula | C9H8ClNO2 |
| Molecular Weight | 197.62 g/mol |
| Exact Mass | 197.02 |
| IUPAC Name | 6-chloro-2-methyl-2,3-dihydropyrano[2,3-b]pyridin-4-one |
| SMILES | CC1CC(=O)c2cc(Cl)cnc2O1 |
| InChI | InChI=1S/C9H8ClNO2/c1-5-2-8(12)7-3-6(10)4-11-9(7)13-5/h3-5H,2H2,1H3 |
| InChIKey | AIKIQDOZEGMIKK-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.62 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-chloro-2-methyl-2,3-dihydropyrano[2,3-b]pyridin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-2-methyl-2,3-dihydropyrano[2,3-b]pyridin-4-one?
The IUPAC name of 6-chloro-2-methyl-2,3-dihydropyrano[2,3-b]pyridin-4-one (CID 14371710) is 6-chloro-2-methyl-2,3-dihydropyrano[2,3-b]pyridin-4-one.
What is the SMILES notation for 6-chloro-2-methyl-2,3-dihydropyrano[2,3-b]pyridin-4-one?
The canonical SMILES for 6-chloro-2-methyl-2,3-dihydropyrano[2,3-b]pyridin-4-one is CC1CC(=O)c2cc(Cl)cnc2O1.
What is the InChIKey of 6-chloro-2-methyl-2,3-dihydropyrano[2,3-b]pyridin-4-one?
The InChIKey is AIKIQDOZEGMIKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8ClNO2/c1-5-2-8(12)7-3-6(10)4-11-9(7)13-5/h3-5H,2H2,1H3.
What are the key properties of 6-chloro-2-methyl-2,3-dihydropyrano[2,3-b]pyridin-4-one?
6-chloro-2-methyl-2,3-dihydropyrano[2,3-b]pyridin-4-one has a molecular weight of 197.62 g/mol, XLogP of 2.09, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-2-methyl-2,3-dihydropyrano[2,3-b]pyridin-4-one is sourced from PubChem (CID 14371710), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).