C11H10ClN3O4 — CID 14371716
(2R,4S)-6-chloro-2-methyl-8-oxidospiro[2,3-dihydropyrano[2,3-b]pyridin-8-ium-4,5'-imidazolidine]-2',4'-dione (PubChem CID 14371716) has the molecular formula C11H10ClN3O4 and a molecular weight of 283.67 g/mol. Its IUPAC name is (2R,4S)-6-chloro-2-methyl-8-oxidospiro[2,3-dihydropyrano[2,3-b]pyridin-8-ium-4,5'-imidazolidine]-2',4'-dione.
| Compound Name | (2R,4S)-6-chloro-2-methyl-8-oxidospiro[2,3-dihydropyrano[2,3-b]pyridin-8-ium-4,5'-imidazolidine]-2',4'-dione |
|---|---|
| PubChem CID | 14371716 |
| Molecular Formula | C11H10ClN3O4 |
| Molecular Weight | 283.67 g/mol |
| Exact Mass | 283.04 |
| IUPAC Name | (2R,4S)-6-chloro-2-methyl-8-oxidospiro[2,3-dihydropyrano[2,3-b]pyridin-8-ium-4,5'-imidazolidine]-2',4'-dione |
| SMILES | C[C@@H]1C[C@]2(NC(=O)NC2=O)c2cc(Cl)c[n+]([O-])c2O1 |
| InChI | InChI=1S/C11H10ClN3O4/c1-5-3-11(9(16)13-10(17)14-11)7-2-6(12)4-15(18)8(7)19-5/h2,4-5H,3H2,1H3,(H2,13,14,16,17)/t5-,11+/m1/s1 |
| InChIKey | PDGNPUKHQOYMGH-GCXOYZPQSA-N |
| XLogP | 0.18 |
| TPSA | 94.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.67 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|