C21H32NO6PS — CID 143717429
S-[2-[(cyclohexa-1,5-dien-1-ylmethylamino)-(4-oxaspiro[2.4]hept-5-en-5-ylmethoxy)phosphoryl]oxyethyl] 3-hydroxy-2,2-dimethylpropanethioate (PubChem CID 143717429) has the molecular formula C21H32NO6PS and a molecular weight of 457.53 g/mol. Its IUPAC name is S-[2-[(cyclohexa-1,5-dien-1-ylmethylamino)-(4-oxaspiro[2.4]hept-5-en-5-ylmethoxy)phosphoryl]oxyethyl] 3-hydroxy-2,2-dimethylpropanethioate.
| Compound Name | S-[2-[(cyclohexa-1,5-dien-1-ylmethylamino)-(4-oxaspiro[2.4]hept-5-en-5-ylmethoxy)phosphoryl]oxyethyl] 3-hydroxy-2,2-dimethylpropanethioate |
|---|---|
| PubChem CID | 143717429 |
| Molecular Formula | C21H32NO6PS |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 457.17 |
| IUPAC Name | S-[2-[(cyclohexa-1,5-dien-1-ylmethylamino)-(4-oxaspiro[2.4]hept-5-en-5-ylmethoxy)phosphoryl]oxyethyl] 3-hydroxy-2,2-dimethylpropanethioate |
| SMILES | CC(C)(CO)C(=O)SCCOP(=O)(NCC1=CCCC=C1)OCC1=CCC2(CC2)O1 |
| InChI | InChI=1S/C21H32NO6PS/c1-20(2,16-23)19(24)30-13-12-26-29(25,22-14-17-6-4-3-5-7-17)27-15-18-8-9-21(28-18)10-11-21/h4,6-8,23H,3,5,9-16H2,1-2H3,(H,22,25) |
| InChIKey | ZTZSEWLVWCPCKC-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|