C28H44N2O2 — CID 143718527
(1R,3'R,5S,7'aR,8S,11R,12R)-3,3',6',12-tetramethylspiro[2-azatetracyclo[9.8.0.01,8.012,17]nonadeca-2,17-diene-5,2'-3a,4,5,6,7,7a-hexahydro-3H-furo[3,2-b]pyridine]-15-ol (PubChem CID 143718527) has the molecular formula C28H44N2O2 and a molecular weight of 440.67 g/mol. Its IUPAC name is (1R,3'R,5S,7'aR,8S,11R,12R)-3,3',6',12-tetramethylspiro[2-azatetracyclo[9.8.0.01,8.012,17]nonadeca-2,17-diene-5,2'-3a,4,5,6,7,7a-hexahydro-3H-furo[3,2-b]pyridine]-15-ol.
| Compound Name | (1R,3'R,5S,7'aR,8S,11R,12R)-3,3',6',12-tetramethylspiro[2-azatetracyclo[9.8.0.01,8.012,17]nonadeca-2,17-diene-5,2'-3a,4,5,6,7,7a-hexahydro-3H-furo[3,2-b]pyridine]-15-ol |
|---|---|
| PubChem CID | 143718527 |
| Molecular Formula | C28H44N2O2 |
| Molecular Weight | 440.67 g/mol |
| Exact Mass | 440.34 |
| IUPAC Name | (1R,3'R,5S,7'aR,8S,11R,12R)-3,3',6',12-tetramethylspiro[2-azatetracyclo[9.8.0.01,8.012,17]nonadeca-2,17-diene-5,2'-3a,4,5,6,7,7a-hexahydro-3H-furo[3,2-b]pyridine]-15-ol |
| SMILES | C/C1=N/[C@@]23CC=C4CC(O)CC[C@]4(C)[C@H]2CC[C@H]3CC[C@@]2(C1)O[C@@H]1CC(C)CNC1[C@H]2C |
| InChI | InChI=1S/C28H44N2O2/c1-17-13-23-25(29-16-17)19(3)27(32-23)11-7-20-5-6-24-26(4)10-9-22(31)14-21(26)8-12-28(20,24)30-18(2)15-27/h8,17,19-20,22-25,29,31H,5-7,9-16H2,1-4H3/b30-18-/t17?,19-,20+,22?,23-,24-,25?,26+,27+,28-/m1/s1 |
| InChIKey | SGRCSIZISVXYJO-QZLKHSAHSA-N |
| XLogP | 5.05 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.67 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|