C22H28N2O4 — CID 143718788
2-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethylamino]acetic acid;propane (PubChem CID 143718788) has the molecular formula C22H28N2O4 and a molecular weight of 384.48 g/mol. Its IUPAC name is 2-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethylamino]acetic acid;propane.
| Compound Name | 2-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethylamino]acetic acid;propane |
|---|---|
| PubChem CID | 143718788 |
| Molecular Formula | C22H28N2O4 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | 2-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethylamino]acetic acid;propane |
| SMILES | CCC.O=C(O)CNCCNC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C19H20N2O4.C3H8/c22-18(23)11-20-9-10-21-19(24)25-12-17-15-7-3-1-5-13(15)14-6-2-4-8-16(14)17;1-3-2/h1-8,17,20H,9-12H2,(H,21,24)(H,22,23);3H2,1-2H3 |
| InChIKey | ZXCQKINXXIXDDW-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|