About [methyl(oxo)-λ6-sulfanylidyne]methanol
[methyl(oxo)-λ6-sulfanylidyne]methanol (PubChem CID 143718873) has the molecular formula C2H4O2S
and a molecular weight of 92.12 g/mol. Its IUPAC name is [methyl(oxo)-λ6-sulfanylidyne]methanol.
Molecular Properties
| Compound Name | [methyl(oxo)-λ6-sulfanylidyne]methanol |
| PubChem CID | 143718873 |
| Molecular Formula | C2H4O2S |
| Molecular Weight | 92.12 g/mol |
| Exact Mass | 91.99 |
| IUPAC Name | [methyl(oxo)-λ6-sulfanylidyne]methanol |
| SMILES | CS(=O)#CO |
| InChI | InChI=1S/C2H4O2S/c1-5(4)2-3/h3H,1H3 |
| InChIKey | QVYRZAQYOWSQMP-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 92.12 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [methyl(oxo)-λ6-sulfanylidyne]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [methyl(oxo)-λ6-sulfanylidyne]methanol?
The IUPAC name of [methyl(oxo)-λ6-sulfanylidyne]methanol (CID 143718873) is [methyl(oxo)-λ6-sulfanylidyne]methanol.
What is the SMILES notation for [methyl(oxo)-λ6-sulfanylidyne]methanol?
The canonical SMILES for [methyl(oxo)-λ6-sulfanylidyne]methanol is CS(=O)#CO.
What is the InChIKey of [methyl(oxo)-λ6-sulfanylidyne]methanol?
The InChIKey is QVYRZAQYOWSQMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H4O2S/c1-5(4)2-3/h3H,1H3.
What are the key properties of [methyl(oxo)-λ6-sulfanylidyne]methanol?
[methyl(oxo)-λ6-sulfanylidyne]methanol has a molecular weight of 92.12 g/mol, XLogP of -0.35, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [methyl(oxo)-λ6-sulfanylidyne]methanol is sourced from PubChem (CID 143718873), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).