C25H37N3 — CID 143718928
ethane;(5Z)-2-ethenyl-6-ethenylimino-5-ethylidene-N,N-dimethyl-4-methylidene-3-prop-2-enyliminocyclohexen-1-amine;2-methylbuta-1,3-diene (PubChem CID 143718928) has the molecular formula C25H37N3 and a molecular weight of 379.59 g/mol. Its IUPAC name is ethane;(5Z)-2-ethenyl-6-ethenylimino-5-ethylidene-N,N-dimethyl-4-methylidene-3-prop-2-enyliminocyclohexen-1-amine;2-methylbuta-1,3-diene.
| Compound Name | ethane;(5Z)-2-ethenyl-6-ethenylimino-5-ethylidene-N,N-dimethyl-4-methylidene-3-prop-2-enyliminocyclohexen-1-amine;2-methylbuta-1,3-diene |
|---|---|
| PubChem CID | 143718928 |
| Molecular Formula | C25H37N3 |
| Molecular Weight | 379.59 g/mol |
| Exact Mass | 379.30 |
| IUPAC Name | ethane;(5Z)-2-ethenyl-6-ethenylimino-5-ethylidene-N,N-dimethyl-4-methylidene-3-prop-2-enyliminocyclohexen-1-amine;2-methylbuta-1,3-diene |
| SMILES | C=CC(=C)C.C=CC/N=C1\C(=C)C(=C/C)/C(=N\C=C)C(N(C)C)=C1C=C.CC |
| InChI | InChI=1S/C18H23N3.C5H8.C2H6/c1-8-12-20-16-13(5)14(9-2)17(19-11-4)18(21(6)7)15(16)10-3;1-4-5(2)3;1-2/h8-11H,1,3-5,12H2,2,6-7H3;4H,1-2H2,3H3;1-2H3/b14-9-,19-17+,20-16+;; |
| InChIKey | PVVBGCHLRAHVNG-OPFXNHRMSA-N |
| XLogP | 6.49 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.59 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|