C20H31FN8 — CID 143719361
3-[3-fluoro-4-[4-(5-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-3-yl)piperidin-1-yl]phenyl]-1,2-dihydro-1,2,4-triazole-3,5-diamine (PubChem CID 143719361) has the molecular formula C20H31FN8 and a molecular weight of 402.52 g/mol. Its IUPAC name is 3-[3-fluoro-4-[4-(5-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-3-yl)piperidin-1-yl]phenyl]-1,2-dihydro-1,2,4-triazole-3,5-diamine.
| Compound Name | 3-[3-fluoro-4-[4-(5-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-3-yl)piperidin-1-yl]phenyl]-1,2-dihydro-1,2,4-triazole-3,5-diamine |
|---|---|
| PubChem CID | 143719361 |
| Molecular Formula | C20H31FN8 |
| Molecular Weight | 402.52 g/mol |
| Exact Mass | 402.27 |
| IUPAC Name | 3-[3-fluoro-4-[4-(5-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-3-yl)piperidin-1-yl]phenyl]-1,2-dihydro-1,2,4-triazole-3,5-diamine |
| SMILES | CN1CC2CNC(C3CCN(c4ccc(C5(N)N=C(N)NN5)cc4F)CC3)C2C1 |
| InChI | InChI=1S/C20H31FN8/c1-28-10-13-9-24-18(15(13)11-28)12-4-6-29(7-5-12)17-3-2-14(8-16(17)21)20(23)25-19(22)26-27-20/h2-3,8,12-13,15,18,24,27H,4-7,9-11,23H2,1H3,(H3,22,25,26) |
| InChIKey | KIYIGAZRRAPARN-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.52 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |