C17H28N6 — CID 143719378
3-[7-(diethylamino)-6,7,8,9-tetrahydro-5H-benzo[7]annulen-3-yl]-1,2-dihydro-1,2,4-triazole-3,5-diamine (PubChem CID 143719378) has the molecular formula C17H28N6 and a molecular weight of 316.45 g/mol. Its IUPAC name is 3-[7-(diethylamino)-6,7,8,9-tetrahydro-5H-benzo[7]annulen-3-yl]-1,2-dihydro-1,2,4-triazole-3,5-diamine.
| Compound Name | 3-[7-(diethylamino)-6,7,8,9-tetrahydro-5H-benzo[7]annulen-3-yl]-1,2-dihydro-1,2,4-triazole-3,5-diamine |
|---|---|
| PubChem CID | 143719378 |
| Molecular Formula | C17H28N6 |
| Molecular Weight | 316.45 g/mol |
| Exact Mass | 316.24 |
| IUPAC Name | 3-[7-(diethylamino)-6,7,8,9-tetrahydro-5H-benzo[7]annulen-3-yl]-1,2-dihydro-1,2,4-triazole-3,5-diamine |
| SMILES | CCN(CC)C1CCc2ccc(C3(N)N=C(N)NN3)cc2CC1 |
| InChI | InChI=1S/C17H28N6/c1-3-23(4-2)15-9-6-12-5-8-14(11-13(12)7-10-15)17(19)20-16(18)21-22-17/h5,8,11,15,22H,3-4,6-7,9-10,19H2,1-2H3,(H3,18,20,21) |
| InChIKey | SQKOAEREDJNQHE-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 91.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.45 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |