About (2Z)-2-(5-imino-2,3-dihydro-1-benzothiepin-4-ylidene)-N'-methylethanimidamide
(2Z)-2-(5-imino-2,3-dihydro-1-benzothiepin-4-ylidene)-N'-methylethanimidamide (PubChem CID 143719451) has the molecular formula C13H15N3S
and a molecular weight of 245.35 g/mol. Its IUPAC name is (2Z)-2-(5-imino-2,3-dihydro-1-benzothiepin-4-ylidene)-N'-methylethanimidamide.
Molecular Properties
| Compound Name | (2Z)-2-(5-imino-2,3-dihydro-1-benzothiepin-4-ylidene)-N'-methylethanimidamide |
| PubChem CID | 143719451 |
| Molecular Formula | C13H15N3S |
| Molecular Weight | 245.35 g/mol |
| Exact Mass | 245.10 |
| IUPAC Name | (2Z)-2-(5-imino-2,3-dihydro-1-benzothiepin-4-ylidene)-N'-methylethanimidamide |
| SMILES | [H]/N=C1C(=C\C(N)=N\C)/CCSc2ccccc2/1 |
| InChI | InChI=1S/C13H15N3S/c1-16-12(14)8-9-6-7-17-11-5-3-2-4-10(11)13(9)15/h2-5,8,15H,6-7H2,1H3,(H2,14,16)/b9-8-,15-13- |
| InChIKey | CWQUGTMHGGPMBG-JDQZXNMFSA-N |
| XLogP | 2.46 |
| TPSA | 62.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.35 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze (2Z)-2-(5-imino-2,3-dihydro-1-benzothiepin-4-ylidene)-N'-methylethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z)-2-(5-imino-2,3-dihydro-1-benzothiepin-4-ylidene)-N'-methylethanimidamide?
The IUPAC name of (2Z)-2-(5-imino-2,3-dihydro-1-benzothiepin-4-ylidene)-N'-methylethanimidamide (CID 143719451) is (2Z)-2-(5-imino-2,3-dihydro-1-benzothiepin-4-ylidene)-N'-methylethanimidamide.
What is the SMILES notation for (2Z)-2-(5-imino-2,3-dihydro-1-benzothiepin-4-ylidene)-N'-methylethanimidamide?
The canonical SMILES for (2Z)-2-(5-imino-2,3-dihydro-1-benzothiepin-4-ylidene)-N'-methylethanimidamide is [H]/N=C1C(=C\C(N)=N\C)/CCSc2ccccc2/1.
What is the InChIKey of (2Z)-2-(5-imino-2,3-dihydro-1-benzothiepin-4-ylidene)-N'-methylethanimidamide?
The InChIKey is CWQUGTMHGGPMBG-JDQZXNMFSA-N. The full InChI is InChI=1S/C13H15N3S/c1-16-12(14)8-9-6-7-17-11-5-3-2-4-10(11)13(9)15/h2-5,8,15H,6-7H2,1H3,(H2,14,16)/b9-8-,15-13-.
What are the key properties of (2Z)-2-(5-imino-2,3-dihydro-1-benzothiepin-4-ylidene)-N'-methylethanimidamide?
(2Z)-2-(5-imino-2,3-dihydro-1-benzothiepin-4-ylidene)-N'-methylethanimidamide has a molecular weight of 245.35 g/mol, XLogP of 2.46, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-2-(5-imino-2,3-dihydro-1-benzothiepin-4-ylidene)-N'-methylethanimidamide is sourced from PubChem (CID 143719451), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).