C26H34BrNO5 — CID 143719652
ethyl (2R)-4-[[4-(2-bromoethoxy)-4-oxobutanoyl]amino]-2-methylbutanoate;1-methyl-4-phenylbenzene (PubChem CID 143719652) has the molecular formula C26H34BrNO5 and a molecular weight of 520.46 g/mol. Its IUPAC name is ethyl (2R)-4-[[4-(2-bromoethoxy)-4-oxobutanoyl]amino]-2-methylbutanoate;1-methyl-4-phenylbenzene.
| Compound Name | ethyl (2R)-4-[[4-(2-bromoethoxy)-4-oxobutanoyl]amino]-2-methylbutanoate;1-methyl-4-phenylbenzene |
|---|---|
| PubChem CID | 143719652 |
| Molecular Formula | C26H34BrNO5 |
| Molecular Weight | 520.46 g/mol |
| Exact Mass | 519.16 |
| IUPAC Name | ethyl (2R)-4-[[4-(2-bromoethoxy)-4-oxobutanoyl]amino]-2-methylbutanoate;1-methyl-4-phenylbenzene |
| SMILES | CCOC(=O)[C@H](C)CCNC(=O)CCC(=O)OCCBr.Cc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C13H22BrNO5.C13H12/c1-3-19-13(18)10(2)6-8-15-11(16)4-5-12(17)20-9-7-14;1-11-7-9-13(10-8-11)12-5-3-2-4-6-12/h10H,3-9H2,1-2H3,(H,15,16);2-10H,1H3/t10-;/m1./s1 |
| InChIKey | QAWOBSXRYCQQRJ-HNCPQSOCSA-N |
| XLogP | 5.07 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.46 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|