C24H35NO3 — CID 143719686
formic acid;(5S)-5-[(4-phenylphenyl)methyl]pyrrolidin-2-one;propane (PubChem CID 143719686) has the molecular formula C24H35NO3 and a molecular weight of 385.55 g/mol. Its IUPAC name is formic acid;(5S)-5-[(4-phenylphenyl)methyl]pyrrolidin-2-one;propane.
| Compound Name | formic acid;(5S)-5-[(4-phenylphenyl)methyl]pyrrolidin-2-one;propane |
|---|---|
| PubChem CID | 143719686 |
| Molecular Formula | C24H35NO3 |
| Molecular Weight | 385.55 g/mol |
| Exact Mass | 385.26 |
| IUPAC Name | formic acid;(5S)-5-[(4-phenylphenyl)methyl]pyrrolidin-2-one;propane |
| SMILES | CCC.CCC.O=C1CC[C@@H](Cc2ccc(-c3ccccc3)cc2)N1.O=CO |
| InChI | InChI=1S/C17H17NO.2C3H8.CH2O2/c19-17-11-10-16(18-17)12-13-6-8-15(9-7-13)14-4-2-1-3-5-14;2*1-3-2;2-1-3/h1-9,16H,10-12H2,(H,18,19);2*3H2,1-2H3;1H,(H,2,3)/t16-;;;/m0.../s1 |
| InChIKey | UOXNNXKJPGSRAT-OKUPDQQSSA-N |
| XLogP | 5.71 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.55 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|