About formic acid;(5S)-5-[(4-phenylphenyl)methyl]pyrrolidin-2-one;propane
formic acid;(5S)-5-[(4-phenylphenyl)methyl]pyrrolidin-2-one;propane (PubChem CID 143719686) has the molecular formula C24H35NO3
and a molecular weight of 385.55 g/mol. Its IUPAC name is formic acid;(5S)-5-[(4-phenylphenyl)methyl]pyrrolidin-2-one;propane.
Molecular Properties
| Compound Name | formic acid;(5S)-5-[(4-phenylphenyl)methyl]pyrrolidin-2-one;propane |
| PubChem CID | 143719686 |
| Molecular Formula | C24H35NO3 |
| Molecular Weight | 385.55 g/mol |
| Exact Mass | 385.26 |
| IUPAC Name | formic acid;(5S)-5-[(4-phenylphenyl)methyl]pyrrolidin-2-one;propane |
| SMILES | CCC.CCC.O=C1CC[C@@H](Cc2ccc(-c3ccccc3)cc2)N1.O=CO |
| InChI | InChI=1S/C17H17NO.2C3H8.CH2O2/c19-17-11-10-16(18-17)12-13-6-8-15(9-7-13)14-4-2-1-3-5-14;2*1-3-2;2-1-3/h1-9,16H,10-12H2,(H,18,19);2*3H2,1-2H3;1H,(H,2,3)/t16-;;;/m0.../s1 |
| InChIKey | UOXNNXKJPGSRAT-OKUPDQQSSA-N |
| XLogP | 5.71 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 385.55 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze formic acid;(5S)-5-[(4-phenylphenyl)methyl]pyrrolidin-2-one;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formic acid;(5S)-5-[(4-phenylphenyl)methyl]pyrrolidin-2-one;propane?
The IUPAC name of formic acid;(5S)-5-[(4-phenylphenyl)methyl]pyrrolidin-2-one;propane (CID 143719686) is formic acid;(5S)-5-[(4-phenylphenyl)methyl]pyrrolidin-2-one;propane.
What is the SMILES notation for formic acid;(5S)-5-[(4-phenylphenyl)methyl]pyrrolidin-2-one;propane?
The canonical SMILES for formic acid;(5S)-5-[(4-phenylphenyl)methyl]pyrrolidin-2-one;propane is CCC.CCC.O=C1CC[C@@H](Cc2ccc(-c3ccccc3)cc2)N1.O=CO.
What is the InChIKey of formic acid;(5S)-5-[(4-phenylphenyl)methyl]pyrrolidin-2-one;propane?
The InChIKey is UOXNNXKJPGSRAT-OKUPDQQSSA-N. The full InChI is InChI=1S/C17H17NO.2C3H8.CH2O2/c19-17-11-10-16(18-17)12-13-6-8-15(9-7-13)14-4-2-1-3-5-14;2*1-3-2;2-1-3/h1-9,16H,10-12H2,(H,18,19);2*3H2,1-2H3;1H,(H,2,3)/t16-;;;/m0.../s1.
What are the key properties of formic acid;(5S)-5-[(4-phenylphenyl)methyl]pyrrolidin-2-one;propane?
formic acid;(5S)-5-[(4-phenylphenyl)methyl]pyrrolidin-2-one;propane has a molecular weight of 385.55 g/mol, XLogP of 5.71, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for formic acid;(5S)-5-[(4-phenylphenyl)methyl]pyrrolidin-2-one;propane is sourced from PubChem (CID 143719686), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).