C27H37N3O3S2 — CID 143719919
1-[[2-[[cyclohexyl(4-phenylbutyl)carbamoyl]amino]-1,3-thiazol-5-yl]sulfanyl]cyclohexane-1-carboxylic acid (PubChem CID 143719919) has the molecular formula C27H37N3O3S2 and a molecular weight of 515.75 g/mol. Its IUPAC name is 1-[[2-[[cyclohexyl(4-phenylbutyl)carbamoyl]amino]-1,3-thiazol-5-yl]sulfanyl]cyclohexane-1-carboxylic acid.
| Compound Name | 1-[[2-[[cyclohexyl(4-phenylbutyl)carbamoyl]amino]-1,3-thiazol-5-yl]sulfanyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 143719919 |
| Molecular Formula | C27H37N3O3S2 |
| Molecular Weight | 515.75 g/mol |
| Exact Mass | 515.23 |
| IUPAC Name | 1-[[2-[[cyclohexyl(4-phenylbutyl)carbamoyl]amino]-1,3-thiazol-5-yl]sulfanyl]cyclohexane-1-carboxylic acid |
| SMILES | O=C(Nc1ncc(SC2(C(=O)O)CCCCC2)s1)N(CCCCc1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C27H37N3O3S2/c31-24(32)27(17-9-3-10-18-27)35-23-20-28-25(34-23)29-26(33)30(22-15-6-2-7-16-22)19-11-8-14-21-12-4-1-5-13-21/h1,4-5,12-13,20,22H,2-3,6-11,14-19H2,(H,31,32)(H,28,29,33) |
| InChIKey | CELOXBAVXWJFKL-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.75 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|