C20H21IN4O2 — CID 143720146
3-(4-aminocyclohexyl)-1-(3-iodophenyl)-6-methylpyrido[2,3-d]pyrimidine-2,4-dione (PubChem CID 143720146) has the molecular formula C20H21IN4O2 and a molecular weight of 476.32 g/mol. Its IUPAC name is 3-(4-aminocyclohexyl)-1-(3-iodophenyl)-6-methylpyrido[2,3-d]pyrimidine-2,4-dione.
| Compound Name | 3-(4-aminocyclohexyl)-1-(3-iodophenyl)-6-methylpyrido[2,3-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 143720146 |
| Molecular Formula | C20H21IN4O2 |
| Molecular Weight | 476.32 g/mol |
| Exact Mass | 476.07 |
| IUPAC Name | 3-(4-aminocyclohexyl)-1-(3-iodophenyl)-6-methylpyrido[2,3-d]pyrimidine-2,4-dione |
| SMILES | Cc1cnc2c(c1)c(=O)n(C1CCC(N)CC1)c(=O)n2-c1cccc(I)c1 |
| InChI | InChI=1S/C20H21IN4O2/c1-12-9-17-18(23-11-12)24(16-4-2-3-13(21)10-16)20(27)25(19(17)26)15-7-5-14(22)6-8-15/h2-4,9-11,14-15H,5-8,22H2,1H3 |
| InChIKey | YZQUBTWYPHOIKM-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 82.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.32 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|