C27H36FN7O3S — CID 143720414
6-(aminomethyl)-N-[4-[6-fluoro-2,4-dioxo-1-(thian-4-yl)pyrido[2,3-d]pyrimidin-3-yl]cyclohexyl]-1,5,6,7,8,8a-hexahydroimidazo[1,2-a]pyridine-2-carboxamide (PubChem CID 143720414) has the molecular formula C27H36FN7O3S and a molecular weight of 557.70 g/mol. Its IUPAC name is 6-(aminomethyl)-N-[4-[6-fluoro-2,4-dioxo-1-(thian-4-yl)pyrido[2,3-d]pyrimidin-3-yl]cyclohexyl]-1,5,6,7,8,8a-hexahydroimidazo[1,2-a]pyridine-2-carboxamide.
| Compound Name | 6-(aminomethyl)-N-[4-[6-fluoro-2,4-dioxo-1-(thian-4-yl)pyrido[2,3-d]pyrimidin-3-yl]cyclohexyl]-1,5,6,7,8,8a-hexahydroimidazo[1,2-a]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 143720414 |
| Molecular Formula | C27H36FN7O3S |
| Molecular Weight | 557.70 g/mol |
| Exact Mass | 557.26 |
| IUPAC Name | 6-(aminomethyl)-N-[4-[6-fluoro-2,4-dioxo-1-(thian-4-yl)pyrido[2,3-d]pyrimidin-3-yl]cyclohexyl]-1,5,6,7,8,8a-hexahydroimidazo[1,2-a]pyridine-2-carboxamide |
| SMILES | NCC1CCC2NC(C(=O)NC3CCC(n4c(=O)c5cc(F)cnc5n(C5CCSCC5)c4=O)CC3)=CN2C1 |
| InChI | InChI=1S/C27H36FN7O3S/c28-17-11-21-24(30-13-17)34(20-7-9-39-10-8-20)27(38)35(26(21)37)19-4-2-18(3-5-19)31-25(36)22-15-33-14-16(12-29)1-6-23(33)32-22/h11,13,15-16,18-20,23,32H,1-10,12,14,29H2,(H,31,36) |
| InChIKey | AWBJYZUAZYKRNV-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 127.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.70 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |