About 6-bromo-3-N-ethynyl-4-methylpyridine-2,3-diamine;ethane
6-bromo-3-N-ethynyl-4-methylpyridine-2,3-diamine;ethane (PubChem CID 143720515) has the molecular formula C10H14BrN3
and a molecular weight of 256.15 g/mol. Its IUPAC name is 6-bromo-3-N-ethynyl-4-methylpyridine-2,3-diamine;ethane.
Molecular Properties
| Compound Name | 6-bromo-3-N-ethynyl-4-methylpyridine-2,3-diamine;ethane |
| PubChem CID | 143720515 |
| Molecular Formula | C10H14BrN3 |
| Molecular Weight | 256.15 g/mol |
| Exact Mass | 255.04 |
| IUPAC Name | 6-bromo-3-N-ethynyl-4-methylpyridine-2,3-diamine;ethane |
| SMILES | C#CNc1c(C)cc(Br)nc1N.CC |
| InChI | InChI=1S/C8H8BrN3.C2H6/c1-3-11-7-5(2)4-6(9)12-8(7)10;1-2/h1,4,11H,2H3,(H2,10,12);1-2H3 |
| InChIKey | BLFRULNOQSSPLZ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.15 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-bromo-3-N-ethynyl-4-methylpyridine-2,3-diamine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-3-N-ethynyl-4-methylpyridine-2,3-diamine;ethane?
The IUPAC name of 6-bromo-3-N-ethynyl-4-methylpyridine-2,3-diamine;ethane (CID 143720515) is 6-bromo-3-N-ethynyl-4-methylpyridine-2,3-diamine;ethane.
What is the SMILES notation for 6-bromo-3-N-ethynyl-4-methylpyridine-2,3-diamine;ethane?
The canonical SMILES for 6-bromo-3-N-ethynyl-4-methylpyridine-2,3-diamine;ethane is C#CNc1c(C)cc(Br)nc1N.CC.
What is the InChIKey of 6-bromo-3-N-ethynyl-4-methylpyridine-2,3-diamine;ethane?
The InChIKey is BLFRULNOQSSPLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8BrN3.C2H6/c1-3-11-7-5(2)4-6(9)12-8(7)10;1-2/h1,4,11H,2H3,(H2,10,12);1-2H3.
What are the key properties of 6-bromo-3-N-ethynyl-4-methylpyridine-2,3-diamine;ethane?
6-bromo-3-N-ethynyl-4-methylpyridine-2,3-diamine;ethane has a molecular weight of 256.15 g/mol, XLogP of 2.76, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-3-N-ethynyl-4-methylpyridine-2,3-diamine;ethane is sourced from PubChem (CID 143720515), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).