About (3E)-3-(2-methyl-6,7-dihydrocyclopenta[e]indazol-8-ylidene)propanenitrile
(3E)-3-(2-methyl-6,7-dihydrocyclopenta[e]indazol-8-ylidene)propanenitrile (PubChem CID 143720887) has the molecular formula C14H13N3
and a molecular weight of 223.28 g/mol. Its IUPAC name is (3E)-3-(2-methyl-6,7-dihydrocyclopenta[e]indazol-8-ylidene)propanenitrile.
Molecular Properties
| Compound Name | (3E)-3-(2-methyl-6,7-dihydrocyclopenta[e]indazol-8-ylidene)propanenitrile |
| PubChem CID | 143720887 |
| Molecular Formula | C14H13N3 |
| Molecular Weight | 223.28 g/mol |
| Exact Mass | 223.11 |
| IUPAC Name | (3E)-3-(2-methyl-6,7-dihydrocyclopenta[e]indazol-8-ylidene)propanenitrile |
| SMILES | Cn1cc2c3c(ccc2n1)CC/C3=C\CC#N |
| InChI | InChI=1S/C14H13N3/c1-17-9-12-13(16-17)7-6-11-5-4-10(14(11)12)3-2-8-15/h3,6-7,9H,2,4-5H2,1H3/b10-3+ |
| InChIKey | UMAHSAVHAKEDIG-XCVCLJGOSA-N |
| XLogP | 2.82 |
| TPSA | 41.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.28 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3E)-3-(2-methyl-6,7-dihydrocyclopenta[e]indazol-8-ylidene)propanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E)-3-(2-methyl-6,7-dihydrocyclopenta[e]indazol-8-ylidene)propanenitrile?
The IUPAC name of (3E)-3-(2-methyl-6,7-dihydrocyclopenta[e]indazol-8-ylidene)propanenitrile (CID 143720887) is (3E)-3-(2-methyl-6,7-dihydrocyclopenta[e]indazol-8-ylidene)propanenitrile.
What is the SMILES notation for (3E)-3-(2-methyl-6,7-dihydrocyclopenta[e]indazol-8-ylidene)propanenitrile?
The canonical SMILES for (3E)-3-(2-methyl-6,7-dihydrocyclopenta[e]indazol-8-ylidene)propanenitrile is Cn1cc2c3c(ccc2n1)CC/C3=C\CC#N.
What is the InChIKey of (3E)-3-(2-methyl-6,7-dihydrocyclopenta[e]indazol-8-ylidene)propanenitrile?
The InChIKey is UMAHSAVHAKEDIG-XCVCLJGOSA-N. The full InChI is InChI=1S/C14H13N3/c1-17-9-12-13(16-17)7-6-11-5-4-10(14(11)12)3-2-8-15/h3,6-7,9H,2,4-5H2,1H3/b10-3+.
What are the key properties of (3E)-3-(2-methyl-6,7-dihydrocyclopenta[e]indazol-8-ylidene)propanenitrile?
(3E)-3-(2-methyl-6,7-dihydrocyclopenta[e]indazol-8-ylidene)propanenitrile has a molecular weight of 223.28 g/mol, XLogP of 2.82, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3E)-3-(2-methyl-6,7-dihydrocyclopenta[e]indazol-8-ylidene)propanenitrile is sourced from PubChem (CID 143720887), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).