C16H20N4O6 — CID 143720958
2-N-[(3,4-dimethoxyphenyl)methyl]-5-(methylperoxymethyl)-3-nitropyridine-2,4-diamine (PubChem CID 143720958) has the molecular formula C16H20N4O6 and a molecular weight of 364.36 g/mol. Its IUPAC name is 2-N-[(3,4-dimethoxyphenyl)methyl]-5-(methylperoxymethyl)-3-nitropyridine-2,4-diamine.
| Compound Name | 2-N-[(3,4-dimethoxyphenyl)methyl]-5-(methylperoxymethyl)-3-nitropyridine-2,4-diamine |
|---|---|
| PubChem CID | 143720958 |
| Molecular Formula | C16H20N4O6 |
| Molecular Weight | 364.36 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | 2-N-[(3,4-dimethoxyphenyl)methyl]-5-(methylperoxymethyl)-3-nitropyridine-2,4-diamine |
| SMILES | COOCc1cnc(NCc2ccc(OC)c(OC)c2)c([N+](=O)[O-])c1N |
| InChI | InChI=1S/C16H20N4O6/c1-23-12-5-4-10(6-13(12)24-2)7-18-16-15(20(21)22)14(17)11(8-19-16)9-26-25-3/h4-6,8H,7,9H2,1-3H3,(H3,17,18,19) |
| InChIKey | YKPXNXMGCFFWFX-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 131.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.36 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|