About 1-furo[3,2-c]pyridin-6-yl-N,N-dimethylmethanamine
1-furo[3,2-c]pyridin-6-yl-N,N-dimethylmethanamine (PubChem CID 14372150) has the molecular formula C10H12N2O
and a molecular weight of 176.22 g/mol. Its IUPAC name is 1-furo[3,2-c]pyridin-6-yl-N,N-dimethylmethanamine.
Molecular Properties
| Compound Name | 1-furo[3,2-c]pyridin-6-yl-N,N-dimethylmethanamine |
| PubChem CID | 14372150 |
| Molecular Formula | C10H12N2O |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.09 |
| IUPAC Name | 1-furo[3,2-c]pyridin-6-yl-N,N-dimethylmethanamine |
| SMILES | CN(C)Cc1cc2occc2cn1 |
| InChI | InChI=1S/C10H12N2O/c1-12(2)7-9-5-10-8(6-11-9)3-4-13-10/h3-6H,7H2,1-2H3 |
| InChIKey | KPRXKUVBZQTUJY-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 29.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-furo[3,2-c]pyridin-6-yl-N,N-dimethylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-furo[3,2-c]pyridin-6-yl-N,N-dimethylmethanamine?
The IUPAC name of 1-furo[3,2-c]pyridin-6-yl-N,N-dimethylmethanamine (CID 14372150) is 1-furo[3,2-c]pyridin-6-yl-N,N-dimethylmethanamine.
What is the SMILES notation for 1-furo[3,2-c]pyridin-6-yl-N,N-dimethylmethanamine?
The canonical SMILES for 1-furo[3,2-c]pyridin-6-yl-N,N-dimethylmethanamine is CN(C)Cc1cc2occc2cn1.
What is the InChIKey of 1-furo[3,2-c]pyridin-6-yl-N,N-dimethylmethanamine?
The InChIKey is KPRXKUVBZQTUJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2O/c1-12(2)7-9-5-10-8(6-11-9)3-4-13-10/h3-6H,7H2,1-2H3.
What are the key properties of 1-furo[3,2-c]pyridin-6-yl-N,N-dimethylmethanamine?
1-furo[3,2-c]pyridin-6-yl-N,N-dimethylmethanamine has a molecular weight of 176.22 g/mol, XLogP of 1.89, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-furo[3,2-c]pyridin-6-yl-N,N-dimethylmethanamine is sourced from PubChem (CID 14372150), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).