furo[2,3-b]pyridine-5-carboxylic acid

C8H5NO3 — CID 14372168

IUPACfuro[2,3-b]pyridine-5-carboxylic acid
SMILESO=C(O)c1cnc2occc2c1
InChIInChI=1S/C8H5NO3/c10-8(11)6-3-5-1-2-12-7(5)9-4-6/h1-4H,(H,10,11)
InChIKeyYBPWMRNKTGNBML-UHFFFAOYSA-N
MW163.13 g/mol
LogP1.53
Rot. Bonds1

About furo[2,3-b]pyridine-5-carboxylic acid

furo[2,3-b]pyridine-5-carboxylic acid (PubChem CID 14372168) has the molecular formula C8H5NO3 and a molecular weight of 163.13 g/mol. Its IUPAC name is furo[2,3-b]pyridine-5-carboxylic acid.

Molecular Properties

Compound Namefuro[2,3-b]pyridine-5-carboxylic acid
PubChem CID14372168
Molecular FormulaC8H5NO3
Molecular Weight163.13 g/mol
Exact Mass163.03
IUPAC Namefuro[2,3-b]pyridine-5-carboxylic acid
SMILESO=C(O)c1cnc2occc2c1
InChIInChI=1S/C8H5NO3/c10-8(11)6-3-5-1-2-12-7(5)9-4-6/h1-4H,(H,10,11)
InChIKeyYBPWMRNKTGNBML-UHFFFAOYSA-N
XLogP1.53
TPSA63.33 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500163.13
LogP ≤ 51.53
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze furo[2,3-b]pyridine-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of furo[2,3-b]pyridine-5-carboxylic acid?
The IUPAC name of furo[2,3-b]pyridine-5-carboxylic acid (CID 14372168) is furo[2,3-b]pyridine-5-carboxylic acid.
What is the SMILES notation for furo[2,3-b]pyridine-5-carboxylic acid?
The canonical SMILES for furo[2,3-b]pyridine-5-carboxylic acid is O=C(O)c1cnc2occc2c1.
What is the InChIKey of furo[2,3-b]pyridine-5-carboxylic acid?
The InChIKey is YBPWMRNKTGNBML-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5NO3/c10-8(11)6-3-5-1-2-12-7(5)9-4-6/h1-4H,(H,10,11).
What are the key properties of furo[2,3-b]pyridine-5-carboxylic acid?
furo[2,3-b]pyridine-5-carboxylic acid has a molecular weight of 163.13 g/mol, XLogP of 1.53, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for furo[2,3-b]pyridine-5-carboxylic acid is sourced from PubChem (CID 14372168), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).