C18H30N2O — CID 143721778
(2Z,4Z,6Z)-N-[[1-(aminomethyl)cyclohexyl]methyl]-2,3-dimethylocta-2,4,6-trienamide (PubChem CID 143721778) has the molecular formula C18H30N2O and a molecular weight of 290.45 g/mol. Its IUPAC name is (2Z,4Z,6Z)-N-[[1-(aminomethyl)cyclohexyl]methyl]-2,3-dimethylocta-2,4,6-trienamide.
| Compound Name | (2Z,4Z,6Z)-N-[[1-(aminomethyl)cyclohexyl]methyl]-2,3-dimethylocta-2,4,6-trienamide |
|---|---|
| PubChem CID | 143721778 |
| Molecular Formula | C18H30N2O |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.24 |
| IUPAC Name | (2Z,4Z,6Z)-N-[[1-(aminomethyl)cyclohexyl]methyl]-2,3-dimethylocta-2,4,6-trienamide |
| SMILES | C/C=C\C=C/C(C)=C(/C)C(=O)NCC1(CN)CCCCC1 |
| InChI | InChI=1S/C18H30N2O/c1-4-5-7-10-15(2)16(3)17(21)20-14-18(13-19)11-8-6-9-12-18/h4-5,7,10H,6,8-9,11-14,19H2,1-3H3,(H,20,21)/b5-4-,10-7-,16-15- |
| InChIKey | CXENBXJTZDIQAO-JZYLHMLESA-N |
| XLogP | 3.48 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|