C18H21FN2 — CID 143721783
3-[(1E,3Z,5Z)-1-(4-fluorophenyl)-2-methylhepta-1,3,5-trienyl]iminobut-1-en-2-amine (PubChem CID 143721783) has the molecular formula C18H21FN2 and a molecular weight of 284.38 g/mol. Its IUPAC name is 3-[(1E,3Z,5Z)-1-(4-fluorophenyl)-2-methylhepta-1,3,5-trienyl]iminobut-1-en-2-amine.
| Compound Name | 3-[(1E,3Z,5Z)-1-(4-fluorophenyl)-2-methylhepta-1,3,5-trienyl]iminobut-1-en-2-amine |
|---|---|
| PubChem CID | 143721783 |
| Molecular Formula | C18H21FN2 |
| Molecular Weight | 284.38 g/mol |
| Exact Mass | 284.17 |
| IUPAC Name | 3-[(1E,3Z,5Z)-1-(4-fluorophenyl)-2-methylhepta-1,3,5-trienyl]iminobut-1-en-2-amine |
| SMILES | C=C(N)/C(C)=N/C(=C(C)/C=C\C=C/C)c1ccc(F)cc1 |
| InChI | InChI=1S/C18H21FN2/c1-5-6-7-8-13(2)18(21-15(4)14(3)20)16-9-11-17(19)12-10-16/h5-12H,3,20H2,1-2,4H3/b6-5-,8-7-,18-13+,21-15+ |
| InChIKey | OSXNYSDHSSYJLQ-UMCLMIKBSA-N |
| XLogP | 4.62 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.38 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|