C21H26N2 — CID 143721792
N-[(4E,6Z,8Z)-3,5-dimethyldeca-1,2,4,6,8-pentaen-4-yl]-1-(3-methylidene-2H-pyridin-5-yl)propan-2-imine (PubChem CID 143721792) has the molecular formula C21H26N2 and a molecular weight of 306.45 g/mol. Its IUPAC name is N-[(4E,6Z,8Z)-3,5-dimethyldeca-1,2,4,6,8-pentaen-4-yl]-1-(3-methylidene-2H-pyridin-5-yl)propan-2-imine.
| Compound Name | N-[(4E,6Z,8Z)-3,5-dimethyldeca-1,2,4,6,8-pentaen-4-yl]-1-(3-methylidene-2H-pyridin-5-yl)propan-2-imine |
|---|---|
| PubChem CID | 143721792 |
| Molecular Formula | C21H26N2 |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.21 |
| IUPAC Name | N-[(4E,6Z,8Z)-3,5-dimethyldeca-1,2,4,6,8-pentaen-4-yl]-1-(3-methylidene-2H-pyridin-5-yl)propan-2-imine |
| SMILES | C=C=C(C)C(/N=C(\C)CC1=CC(=C)CN=C1)=C(C)\C=C/C=C\C |
| InChI | InChI=1S/C21H26N2/c1-7-9-10-11-18(5)21(17(4)8-2)23-19(6)13-20-12-16(3)14-22-15-20/h7,9-12,15H,2-3,13-14H2,1,4-6H3/b9-7-,11-10-,21-18+,23-19+ |
| InChIKey | CSVKRUUXWCBULB-VEEBNFGNSA-N |
| XLogP | 5.54 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|