C26H40N2 — CID 143721823
(2E,4Z,6Z)-2-[[(3E,5Z)-3-ethenylhepta-3,5-dien-2-ylidene]amino]-3-methyl-N-[(1-propan-2-ylcyclobutyl)methyl]octa-2,4,6-trien-1-amine (PubChem CID 143721823) has the molecular formula C26H40N2 and a molecular weight of 380.62 g/mol. Its IUPAC name is (2E,4Z,6Z)-2-[[(3E,5Z)-3-ethenylhepta-3,5-dien-2-ylidene]amino]-3-methyl-N-[(1-propan-2-ylcyclobutyl)methyl]octa-2,4,6-trien-1-amine.
| Compound Name | (2E,4Z,6Z)-2-[[(3E,5Z)-3-ethenylhepta-3,5-dien-2-ylidene]amino]-3-methyl-N-[(1-propan-2-ylcyclobutyl)methyl]octa-2,4,6-trien-1-amine |
|---|---|
| PubChem CID | 143721823 |
| Molecular Formula | C26H40N2 |
| Molecular Weight | 380.62 g/mol |
| Exact Mass | 380.32 |
| IUPAC Name | (2E,4Z,6Z)-2-[[(3E,5Z)-3-ethenylhepta-3,5-dien-2-ylidene]amino]-3-methyl-N-[(1-propan-2-ylcyclobutyl)methyl]octa-2,4,6-trien-1-amine |
| SMILES | C=CC(=C\C=C/C)/C(C)=N/C(CNCC1(C(C)C)CCC1)=C(C)/C=C\C=C/C |
| InChI | InChI=1S/C26H40N2/c1-8-11-13-15-22(6)25(28-23(7)24(10-3)16-12-9-2)19-27-20-26(21(4)5)17-14-18-26/h8-13,15-16,21,27H,3,14,17-20H2,1-2,4-7H3/b11-8-,12-9-,15-13-,24-16+,25-22+,28-23+ |
| InChIKey | DRPFKXJTLQWRCM-JKJFBKKKSA-N |
| XLogP | 6.96 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.62 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|