About 3-ethyltricyclo[5.2.1.03,5]decane;1-imidazo[1,5-a]pyridin-3-ylethanone
3-ethyltricyclo[5.2.1.03,5]decane;1-imidazo[1,5-a]pyridin-3-ylethanone (PubChem CID 143721855) has the molecular formula C21H28N2O
and a molecular weight of 324.47 g/mol. Its IUPAC name is 3-ethyltricyclo[5.2.1.03,5]decane;1-imidazo[1,5-a]pyridin-3-ylethanone.
Molecular Properties
| Compound Name | 3-ethyltricyclo[5.2.1.03,5]decane;1-imidazo[1,5-a]pyridin-3-ylethanone |
| PubChem CID | 143721855 |
| Molecular Formula | C21H28N2O |
| Molecular Weight | 324.47 g/mol |
| Exact Mass | 324.22 |
| IUPAC Name | 3-ethyltricyclo[5.2.1.03,5]decane;1-imidazo[1,5-a]pyridin-3-ylethanone |
| SMILES | CC(=O)c1ncc2ccccn12.CCC12CC3CCC(C3)CC1C2 |
| InChI | InChI=1S/C12H20.C9H8N2O/c1-2-12-7-10-4-3-9(5-10)6-11(12)8-12;1-7(12)9-10-6-8-4-2-3-5-11(8)9/h9-11H,2-8H2,1H3;2-6H,1H3 |
| InChIKey | CQKFJKYADWRTOQ-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 34.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 324.47 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-ethyltricyclo[5.2.1.03,5]decane;1-imidazo[1,5-a]pyridin-3-ylethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyltricyclo[5.2.1.03,5]decane;1-imidazo[1,5-a]pyridin-3-ylethanone?
The IUPAC name of 3-ethyltricyclo[5.2.1.03,5]decane;1-imidazo[1,5-a]pyridin-3-ylethanone (CID 143721855) is 3-ethyltricyclo[5.2.1.03,5]decane;1-imidazo[1,5-a]pyridin-3-ylethanone.
What is the SMILES notation for 3-ethyltricyclo[5.2.1.03,5]decane;1-imidazo[1,5-a]pyridin-3-ylethanone?
The canonical SMILES for 3-ethyltricyclo[5.2.1.03,5]decane;1-imidazo[1,5-a]pyridin-3-ylethanone is CC(=O)c1ncc2ccccn12.CCC12CC3CCC(C3)CC1C2.
What is the InChIKey of 3-ethyltricyclo[5.2.1.03,5]decane;1-imidazo[1,5-a]pyridin-3-ylethanone?
The InChIKey is CQKFJKYADWRTOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20.C9H8N2O/c1-2-12-7-10-4-3-9(5-10)6-11(12)8-12;1-7(12)9-10-6-8-4-2-3-5-11(8)9/h9-11H,2-8H2,1H3;2-6H,1H3.
What are the key properties of 3-ethyltricyclo[5.2.1.03,5]decane;1-imidazo[1,5-a]pyridin-3-ylethanone?
3-ethyltricyclo[5.2.1.03,5]decane;1-imidazo[1,5-a]pyridin-3-ylethanone has a molecular weight of 324.47 g/mol, XLogP of 5.15, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyltricyclo[5.2.1.03,5]decane;1-imidazo[1,5-a]pyridin-3-ylethanone is sourced from PubChem (CID 143721855), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).