About 1-[6-(1-hydroxyethyl)-4,4-dimethyl-2,3-dihydroquinolin-1-yl]ethanone
1-[6-(1-hydroxyethyl)-4,4-dimethyl-2,3-dihydroquinolin-1-yl]ethanone (PubChem CID 14372187) has the molecular formula C15H21NO2
and a molecular weight of 247.34 g/mol. Its IUPAC name is 1-[6-(1-hydroxyethyl)-4,4-dimethyl-2,3-dihydroquinolin-1-yl]ethanone.
Molecular Properties
| Compound Name | 1-[6-(1-hydroxyethyl)-4,4-dimethyl-2,3-dihydroquinolin-1-yl]ethanone |
| PubChem CID | 14372187 |
| Molecular Formula | C15H21NO2 |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.16 |
| IUPAC Name | 1-[6-(1-hydroxyethyl)-4,4-dimethyl-2,3-dihydroquinolin-1-yl]ethanone |
| SMILES | CC(=O)N1CCC(C)(C)c2cc(C(C)O)ccc21 |
| InChI | InChI=1S/C15H21NO2/c1-10(17)12-5-6-14-13(9-12)15(3,4)7-8-16(14)11(2)18/h5-6,9-10,17H,7-8H2,1-4H3 |
| InChIKey | KZEJINABRYVUPX-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[6-(1-hydroxyethyl)-4,4-dimethyl-2,3-dihydroquinolin-1-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[6-(1-hydroxyethyl)-4,4-dimethyl-2,3-dihydroquinolin-1-yl]ethanone?
The IUPAC name of 1-[6-(1-hydroxyethyl)-4,4-dimethyl-2,3-dihydroquinolin-1-yl]ethanone (CID 14372187) is 1-[6-(1-hydroxyethyl)-4,4-dimethyl-2,3-dihydroquinolin-1-yl]ethanone.
What is the SMILES notation for 1-[6-(1-hydroxyethyl)-4,4-dimethyl-2,3-dihydroquinolin-1-yl]ethanone?
The canonical SMILES for 1-[6-(1-hydroxyethyl)-4,4-dimethyl-2,3-dihydroquinolin-1-yl]ethanone is CC(=O)N1CCC(C)(C)c2cc(C(C)O)ccc21.
What is the InChIKey of 1-[6-(1-hydroxyethyl)-4,4-dimethyl-2,3-dihydroquinolin-1-yl]ethanone?
The InChIKey is KZEJINABRYVUPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21NO2/c1-10(17)12-5-6-14-13(9-12)15(3,4)7-8-16(14)11(2)18/h5-6,9-10,17H,7-8H2,1-4H3.
What are the key properties of 1-[6-(1-hydroxyethyl)-4,4-dimethyl-2,3-dihydroquinolin-1-yl]ethanone?
1-[6-(1-hydroxyethyl)-4,4-dimethyl-2,3-dihydroquinolin-1-yl]ethanone has a molecular weight of 247.34 g/mol, XLogP of 2.77, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[6-(1-hydroxyethyl)-4,4-dimethyl-2,3-dihydroquinolin-1-yl]ethanone is sourced from PubChem (CID 14372187), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).