C25H42N2 — CID 143721913
4-ethylaniline;(2Z,4Z,6Z)-N-heptan-4-yl-2,3-dimethylocta-2,4,6-trien-1-amine (PubChem CID 143721913) has the molecular formula C25H42N2 and a molecular weight of 370.63 g/mol. Its IUPAC name is 4-ethylaniline;(2Z,4Z,6Z)-N-heptan-4-yl-2,3-dimethylocta-2,4,6-trien-1-amine.
| Compound Name | 4-ethylaniline;(2Z,4Z,6Z)-N-heptan-4-yl-2,3-dimethylocta-2,4,6-trien-1-amine |
|---|---|
| PubChem CID | 143721913 |
| Molecular Formula | C25H42N2 |
| Molecular Weight | 370.63 g/mol |
| Exact Mass | 370.33 |
| IUPAC Name | 4-ethylaniline;(2Z,4Z,6Z)-N-heptan-4-yl-2,3-dimethylocta-2,4,6-trien-1-amine |
| SMILES | C/C=C\C=C/C(C)=C(/C)CNC(CCC)CCC.CCc1ccc(N)cc1 |
| InChI | InChI=1S/C17H31N.C8H11N/c1-6-9-10-13-15(4)16(5)14-18-17(11-7-2)12-8-3;1-2-7-3-5-8(9)6-4-7/h6,9-10,13,17-18H,7-8,11-12,14H2,1-5H3;3-6H,2,9H2,1H3/b9-6-,13-10-,16-15-; |
| InChIKey | YNDQHFYNWOPVJC-UVBMMJOSSA-N |
| XLogP | 6.84 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.63 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|