C18H25F2N3O — CID 143721928
(2E,4Z,6Z)-2-amino-N-[(5Z,7Z)-2,2-difluoro-8-(methylideneamino)octa-5,7-dien-3-yl]-3-methylocta-2,4,6-trienamide (PubChem CID 143721928) has the molecular formula C18H25F2N3O and a molecular weight of 337.41 g/mol. Its IUPAC name is (2E,4Z,6Z)-2-amino-N-[(5Z,7Z)-2,2-difluoro-8-(methylideneamino)octa-5,7-dien-3-yl]-3-methylocta-2,4,6-trienamide.
| Compound Name | (2E,4Z,6Z)-2-amino-N-[(5Z,7Z)-2,2-difluoro-8-(methylideneamino)octa-5,7-dien-3-yl]-3-methylocta-2,4,6-trienamide |
|---|---|
| PubChem CID | 143721928 |
| Molecular Formula | C18H25F2N3O |
| Molecular Weight | 337.41 g/mol |
| Exact Mass | 337.20 |
| IUPAC Name | (2E,4Z,6Z)-2-amino-N-[(5Z,7Z)-2,2-difluoro-8-(methylideneamino)octa-5,7-dien-3-yl]-3-methylocta-2,4,6-trienamide |
| SMILES | C=N/C=C\C=C/CC(NC(=O)/C(N)=C(C)\C=C/C=C\C)C(C)(F)F |
| InChI | InChI=1S/C18H25F2N3O/c1-5-6-8-11-14(2)16(21)17(24)23-15(18(3,19)20)12-9-7-10-13-22-4/h5-11,13,15H,4,12,21H2,1-3H3,(H,23,24)/b6-5-,9-7-,11-8-,13-10-,16-14+ |
| InChIKey | JDLCCMGWFBNDQO-JUPGPZONSA-N |
| XLogP | 3.65 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.41 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|