C28H53N3 — CID 143721935
1-ethyl-3-methylcyclohexane;methanamine;N-[(2E,4Z,6Z)-3-methyl-1-piperidin-1-ylocta-2,4,6-trien-2-yl]butan-2-imine (PubChem CID 143721935) has the molecular formula C28H53N3 and a molecular weight of 431.75 g/mol. Its IUPAC name is 1-ethyl-3-methylcyclohexane;methanamine;N-[(2E,4Z,6Z)-3-methyl-1-piperidin-1-ylocta-2,4,6-trien-2-yl]butan-2-imine.
| Compound Name | 1-ethyl-3-methylcyclohexane;methanamine;N-[(2E,4Z,6Z)-3-methyl-1-piperidin-1-ylocta-2,4,6-trien-2-yl]butan-2-imine |
|---|---|
| PubChem CID | 143721935 |
| Molecular Formula | C28H53N3 |
| Molecular Weight | 431.75 g/mol |
| Exact Mass | 431.42 |
| IUPAC Name | 1-ethyl-3-methylcyclohexane;methanamine;N-[(2E,4Z,6Z)-3-methyl-1-piperidin-1-ylocta-2,4,6-trien-2-yl]butan-2-imine |
| SMILES | C/C=C\C=C/C(C)=C(CN1CCCCC1)/N=C(\C)CC.CCC1CCCC(C)C1.CN |
| InChI | InChI=1S/C18H30N2.C9H18.CH5N/c1-5-7-9-12-16(3)18(19-17(4)6-2)15-20-13-10-8-11-14-20;1-3-9-6-4-5-8(2)7-9;1-2/h5,7,9,12H,6,8,10-11,13-15H2,1-4H3;8-9H,3-7H2,1-2H3;2H2,1H3/b7-5-,12-9-,18-16+,19-17+;; |
| InChIKey | GQHKMJRMEIGNML-GHXLJRDWSA-N |
| XLogP | 7.55 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.75 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|