C18H27FN2O — CID 143722077
N-[(2E,4E,6Z)-4-fluoro-3-methyl-1-morpholin-4-ylocta-2,4,6-trien-2-yl]-3-methylbut-3-en-2-imine (PubChem CID 143722077) has the molecular formula C18H27FN2O and a molecular weight of 306.43 g/mol. Its IUPAC name is N-[(2E,4E,6Z)-4-fluoro-3-methyl-1-morpholin-4-ylocta-2,4,6-trien-2-yl]-3-methylbut-3-en-2-imine.
| Compound Name | N-[(2E,4E,6Z)-4-fluoro-3-methyl-1-morpholin-4-ylocta-2,4,6-trien-2-yl]-3-methylbut-3-en-2-imine |
|---|---|
| PubChem CID | 143722077 |
| Molecular Formula | C18H27FN2O |
| Molecular Weight | 306.43 g/mol |
| Exact Mass | 306.21 |
| IUPAC Name | N-[(2E,4E,6Z)-4-fluoro-3-methyl-1-morpholin-4-ylocta-2,4,6-trien-2-yl]-3-methylbut-3-en-2-imine |
| SMILES | C=C(C)/C(C)=N/C(CN1CCOCC1)=C(C)/C(F)=C\C=C/C |
| InChI | InChI=1S/C18H27FN2O/c1-6-7-8-17(19)15(4)18(20-16(5)14(2)3)13-21-9-11-22-12-10-21/h6-8H,2,9-13H2,1,3-5H3/b7-6-,17-8+,18-15+,20-16+ |
| InChIKey | DJXKWTDBNXCPKI-WTBKXQRRSA-N |
| XLogP | 4.06 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.43 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|